![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | R-Bert (17334)/ | 2026-01-04 14:12 | - | |
| R-Nest (6142)/ | 2026-01-04 14:12 | - | |
| R - The Ultimate Joystick Killer (6141)/ | 2026-01-04 14:12 | - | |
| R-Type (6143)/ | 2026-01-04 14:12 | - | |
| R-Type [Preview] (14844)/ | 2026-01-04 14:12 | - | |
| R1-D1 (6145)/ | 2026-01-04 14:12 | - | |
| RAD (17064)/ | 2026-01-04 14:12 | - | |
| RADs (9672)/ | 2026-01-04 14:12 | - | |
| RAF (6170)/ | 2026-01-04 14:12 | - | |
| RAMS (6204)/ | 2026-01-04 14:12 | - | |
| RATS! (11288)/ | 2026-01-04 14:12 | - | |
| RBI 2 Baseball (6234)/ | 2026-01-04 14:12 | - | |
| RCA - Radio Controlled Action (6166)/ | 2026-01-04 14:12 | - | |
| RDF 1985 - When Superpowers Collide (9862)/ | 2026-01-04 14:12 | - | |
| RIOT (12251)/ | 2026-01-04 14:12 | - | |
| RISK - Rapid Intercept Seek and Kill (6369)/ | 2026-01-04 14:12 | - | |
| RJ's Ultimatum (6382)/ | 2026-01-04 14:12 | - | |
| RMS Titanic (6383)/ | 2026-01-04 14:12 | - | |
| RSVP (17532)/ | 2026-01-04 14:12 | - | |
| RUN-Trophy '86 (10441)/ | 2026-01-04 14:12 | - | |
| Ra's Revenge (10281)/ | 2026-01-04 14:12 | - | |
| Rabatt-Aventyr (17272)/ | 2026-01-04 14:12 | - | |
| Rabbit-Ball (6147)/ | 2026-01-04 14:12 | - | |
| Rabbit Pie (6146)/ | 2026-01-04 14:12 | - | |
| Rabbit Trap (12772)/ | 2026-01-04 14:12 | - | |
| Race (11572)/ | 2026-01-04 14:12 | - | |
| Race, The (11571)/ | 2026-01-04 14:12 | - | |
| Race-Chase (16104)/ | 2026-01-04 14:12 | - | |
| Race Ace (6148)/ | 2026-01-04 14:12 | - | |
| Race Against Time, The (6149)/ | 2026-01-04 14:12 | - | |
| Race Chase (6150)/ | 2026-01-04 14:12 | - | |
| Race Craze (16837)/ | 2026-01-04 14:12 | - | |
| Race With the Devil (6153)/ | 2026-01-04 14:12 | - | |
| Race for the States (6151)/ | 2026-01-04 14:12 | - | |
| Racehorse Pinochle (12664)/ | 2026-01-04 14:12 | - | |
| Racen (9130)/ | 2026-01-04 14:12 | - | |
| Race of Paris-Dakar, The (5568)/ | 2026-01-04 14:12 | - | |
| Race of the Bones (6152)/ | 2026-01-04 14:12 | - | |
| Racer! (13856)/ | 2026-01-04 14:12 | - | |
| Races, The - Go Racing With Peter O'Sullevan (11600)/ | 2026-01-04 14:12 | - | |
| Racing Car (10235)/ | 2026-01-04 14:12 | - | |
| Racing Destruction Set (6154)/ | 2026-01-04 14:12 | - | |
| Racing Game, The (12073)/ | 2026-01-04 14:12 | - | |
| Racing Manager, The (6155)/ | 2026-01-04 14:12 | - | |
| Rack 'em (6156)/ | 2026-01-04 14:12 | - | |
| Rack 'em Up! (6157)/ | 2026-01-04 14:12 | - | |
| Rad Ramp Racer (6158)/ | 2026-01-04 14:12 | - | |
| Rad Warrior (6159)/ | 2026-01-04 14:12 | - | |
| Radar (6160)/ | 2026-01-04 14:12 | - | |
| Radar (15373)/ | 2026-01-04 14:12 | - | |
| Radar Lander - Caves (11147)/ | 2026-01-04 14:12 | - | |
| Radar Landing (9377)/ | 2026-01-04 14:12 | - | |
| Radar Rat Race (6161)/ | 2026-01-04 14:12 | - | |
| Radar Rat Race (16533)/ | 2026-01-04 14:12 | - | |
| Radax (6162)/ | 2026-01-04 14:12 | - | |
| Radball (15993)/ | 2026-01-04 14:12 | - | |
| Radcliffe in Monsterland (6163)/ | 2026-01-04 14:12 | - | |
| Raddish-One (15613)/ | 2026-01-04 14:12 | - | |
| Raddish-Two (6164)/ | 2026-01-04 14:12 | - | |
| Radeloos (6165)/ | 2026-01-04 14:12 | - | |
| Radio Search (12675)/ | 2026-01-04 14:12 | - | |
| Radiopower (17456)/ | 2026-01-04 14:12 | - | |
| Radius (6167)/ | 2026-01-04 14:12 | - | |
| Radius (6168)/ | 2026-01-04 14:12 | - | |
| Radonium (6169)/ | 2026-01-04 14:12 | - | |
| Raeum ab (16408)/ | 2026-01-04 14:12 | - | |
| Raft-Away River (12783)/ | 2026-01-04 14:12 | - | |
| Rage (6171)/ | 2026-01-04 14:12 | - | |
| Raging Beast - Ole! (6172)/ | 2026-01-04 14:12 | - | |
| Raging Thunder (12246)/ | 2026-01-04 14:12 | - | |
| Rags to Riches (6173)/ | 2026-01-04 14:12 | - | |
| Raid (10564)/ | 2026-01-04 14:12 | - | |
| Raid (11131)/ | 2026-01-04 14:12 | - | |
| Raid (14908)/ | 2026-01-04 14:12 | - | |
| Raid 2000 (6174)/ | 2026-01-04 14:12 | - | |
| Raid Over Moscow (6176)/ | 2026-01-04 14:12 | - | |
| Raider (6177)/ | 2026-01-04 14:12 | - | |
| Raiders from Mars (12782)/ | 2026-01-04 14:12 | - | |
| Raiders of the Lost Arch (6178)/ | 2026-01-04 14:12 | - | |
| Raid on Bungeling Bay (6175)/ | 2026-01-04 14:12 | - | |
| Raid on New York (12209)/ | 2026-01-04 14:12 | - | |
| Raid on Nietegsorg! (15996)/ | 2026-01-04 14:12 | - | |
| Rail (12771)/ | 2026-01-04 14:12 | - | |
| Rail Boss (12781)/ | 2026-01-04 14:12 | - | |
| Rail Road (6179)/ | 2026-01-04 14:12 | - | |
| Rail Roader (16146)/ | 2026-01-04 14:12 | - | |
| Rail Runner (12784)/ | 2026-01-04 14:12 | - | |
| Rail Runner (12785)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Birmingham (12792)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Bristol TM (10271)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Buxton (12768)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Carlisle (12788)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Crewe (12793)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Doncaster (12791)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Exeter (12786)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Kings Cross (12790)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Leeds City (12416)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Liverpool Lime Street (12794)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Manchester Piccadilly (12769)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Penzance (12731)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Peterborough (12787)/ | 2026-01-04 14:12 | - | |
| Rail Traffic Control - Reading (12789)/ | 2026-01-04 14:12 | - | |
| Railroad (6180)/ | 2026-01-04 14:12 | - | |
| Railroad Tycoon (17006)/ | 2026-01-04 14:12 | - | |
| Railroad Works, The (6181)/ | 2026-01-04 14:12 | - | |
| Rails West! (9458)/ | 2026-01-04 14:12 | - | |
| Railwar v3.2 (10919)/ | 2026-01-04 14:12 | - | |
| Rainbow (6182)/ | 2026-01-04 14:12 | - | |
| Rainbow Bomb [Preview] (6183)/ | 2026-01-04 14:12 | - | |
| Rainbow Challenge (12571)/ | 2026-01-04 14:12 | - | |
| Rainbow Chaser (6184)/ | 2026-01-04 14:12 | - | |
| Rainbow Dragon (6185)/ | 2026-01-04 14:12 | - | |
| Rainbow Islands (6186)/ | 2026-01-04 14:12 | - | |
| Rainbow Pinball (15044)/ | 2026-01-04 14:12 | - | |
| Rainbow Runner (6187)/ | 2026-01-04 14:12 | - | |
| Rainbow Square Dance (15545)/ | 2026-01-04 14:12 | - | |
| Rainbow Towers (12796)/ | 2026-01-04 14:12 | - | |
| Rainbow Walker (6188)/ | 2026-01-04 14:12 | - | |
| Rainbow Warrior (6189)/ | 2026-01-04 14:12 | - | |
| Rainfighter (6190)/ | 2026-01-04 14:12 | - | |
| Raingame (10209)/ | 2026-01-04 14:12 | - | |
| Rainy Day Fun (13179)/ | 2026-01-04 14:12 | - | |
| Raketa Kiloeves (6191)/ | 2026-01-04 14:12 | - | |
| Ralli (9092)/ | 2026-01-04 14:12 | - | |
| Rally 2001 (15888)/ | 2026-01-04 14:12 | - | |
| Rally Cross (6192)/ | 2026-01-04 14:12 | - | |
| Rally Cross (6193)/ | 2026-01-04 14:12 | - | |
| Rally Driver (6194)/ | 2026-01-04 14:12 | - | |
| Rally Racer (6195)/ | 2026-01-04 14:12 | - | |
| Rally Shallenge (11100)/ | 2026-01-04 14:12 | - | |
| Rally Simulator (6196)/ | 2026-01-04 14:12 | - | |
| Rally Speedway (3957)/ | 2026-01-04 14:12 | - | |
| Rally Speedway II (3958)/ | 2026-01-04 14:12 | - | |
| Rallye (6197)/ | 2026-01-04 14:12 | - | |
| Rallye (15280)/ | 2026-01-04 14:12 | - | |
| Rallye Racing (16304)/ | 2026-01-04 14:12 | - | |
| Ram Rod (12212)/ | 2026-01-04 14:12 | - | |
| Ramble over Nazca (10659)/ | 2026-01-04 14:12 | - | |
| Rambo - First Blood Part II (6198)/ | 2026-01-04 14:12 | - | |
| Rambo III - The Rescue (6199)/ | 2026-01-04 14:12 | - | |
| Rambo and Rocy (14669)/ | 2026-01-04 14:12 | - | |
| Rampage (6200)/ | 2026-01-04 14:12 | - | |
| Rampage (6201)/ | 2026-01-04 14:12 | - | |
| Rampage (9455)/ | 2026-01-04 14:12 | - | |
| Rampart (6202)/ | 2026-01-04 14:12 | - | |
| Ramparts (6203)/ | 2026-01-04 14:12 | - | |
| Ramses vom Nil (6205)/ | 2026-01-04 14:12 | - | |
| Ramsete (10869)/ | 2026-01-04 14:12 | - | |
| Rana, La (10875)/ | 2026-01-04 14:12 | - | |
| Rana, La (14189)/ | 2026-01-04 14:12 | - | |
| Rana, La (17001)/ | 2026-01-04 14:12 | - | |
| Ranantat (6206)/ | 2026-01-04 14:12 | - | |
| Ranarama (6207)/ | 2026-01-04 14:12 | - | |
| Ranch (6208)/ | 2026-01-04 14:12 | - | |
| Random Champ 8 (6209)/ | 2026-01-04 14:12 | - | |
| Random Division Quiz (14515)/ | 2026-01-04 14:12 | - | |
| Random Maze (15707)/ | 2026-01-04 14:12 | - | |
| Ransack (6211)/ | 2026-01-04 14:12 | - | |
| Ransom (4131)/ | 2026-01-04 14:12 | - | |
| Rapid Fire (6213)/ | 2026-01-04 14:12 | - | |
| Rapina in famiglia (16136)/ | 2026-01-04 14:12 | - | |
| Raptor (14609)/ | 2026-01-04 14:12 | - | |
| Rapunzel mit dem gueldenen Haar (14252)/ | 2026-01-04 14:12 | - | |
| Rascals (6214)/ | 2026-01-04 14:12 | - | |
| Rascan (14047)/ | 2026-01-04 14:12 | - | |
| Rasen-Maeher (15349)/ | 2026-01-04 14:12 | - | |
| Rasenmaeher (6215)/ | 2026-01-04 14:12 | - | |
| Raskel (6216)/ | 2026-01-04 14:12 | - | |
| Rasputin (6217)/ | 2026-01-04 14:12 | - | |
| Rastan (6218)/ | 2026-01-04 14:12 | - | |
| Raster Runner (6219)/ | 2026-01-04 14:12 | - | |
| Rasterscan (6220)/ | 2026-01-04 14:12 | - | |
| Rat, The (12205)/ | 2026-01-04 14:12 | - | |
| Rat-Run (6222)/ | 2026-01-04 14:12 | - | |
| Rat Maze (16057)/ | 2026-01-04 14:12 | - | |
| Rat Splat (6221)/ | 2026-01-04 14:12 | - | |
| Rat Trails (15886)/ | 2026-01-04 14:12 | - | |
| Ratan Ballads (6223)/ | 2026-01-04 14:12 | - | |
| Ratefix (6224)/ | 2026-01-04 14:12 | - | |
| Ratespass (11677)/ | 2026-01-04 14:12 | - | |
| Ratio (14228)/ | 2026-01-04 14:12 | - | |
| Rator (6225)/ | 2026-01-04 14:12 | - | |
| Ratrun (12030)/ | 2026-01-04 14:12 | - | |
| Ratrun (14854)/ | 2026-01-04 14:12 | - | |
| Rats (9411)/ | 2026-01-04 14:12 | - | |
| Rats, The (6226)/ | 2026-01-04 14:12 | - | |
| Rattler (6227)/ | 2026-01-04 14:12 | - | |
| Raumpatrouille (11637)/ | 2026-01-04 14:12 | - | |
| Raumpatrouillie (14705)/ | 2026-01-04 14:12 | - | |
| Raumpirat (6228)/ | 2026-01-04 14:12 | - | |
| Raumpirat (10897)/ | 2026-01-04 14:12 | - | |
| Raumschiff Enterprise (9697)/ | 2026-01-04 14:12 | - | |
| Raumschiff Enterprise (14898)/ | 2026-01-04 14:12 | - | |
| Raven, The (9712)/ | 2026-01-04 14:12 | - | |
| Ravenous - Space Opera 2 (6229)/ | 2026-01-04 14:12 | - | |
| Raw Deal (6230)/ | 2026-01-04 14:12 | - | |
| Raw Recruit (6231)/ | 2026-01-04 14:12 | - | |
| Rawhead Rex [Preview] (6232)/ | 2026-01-04 14:12 | - | |
| Raz-Man (12797)/ | 2026-01-04 14:12 | - | |
| Raz [Preview] (6233)/ | 2026-01-04 14:12 | - | |
| Razor [Preview] (9859)/ | 2026-01-04 14:12 | - | |
| Re-Beep (10694)/ | 2026-01-04 14:12 | - | |
| Re-Bounder (6235)/ | 2026-01-04 14:12 | - | |
| Re Artu (13973)/ | 2026-01-04 14:12 | - | |
| Reach! (13422)/ | 2026-01-04 14:12 | - | |
| Reach for the Stars - The Conquest of the Galaxy (6236)/ | 2026-01-04 14:12 | - | |
| Reach for the Stars v2.0 (6237)/ | 2026-01-04 14:12 | - | |
| Reach for the Stars v3.0 (6238)/ | 2026-01-04 14:12 | - | |
| React (10702)/ | 2026-01-04 14:12 | - | |
| Reaction (6239)/ | 2026-01-04 14:12 | - | |
| Reaction (6240)/ | 2026-01-04 14:12 | - | |
| Reaction (15766)/ | 2026-01-04 14:12 | - | |
| Reaction-Time Tester (15705)/ | 2026-01-04 14:12 | - | |
| Reaction Time (15492)/ | 2026-01-04 14:12 | - | |
| Reactor (6241)/ | 2026-01-04 14:12 | - | |
| Reactor (6242)/ | 2026-01-04 14:12 | - | |
| Reactor II (6243)/ | 2026-01-04 14:12 | - | |
| Reactor Run (6244)/ | 2026-01-04 14:12 | - | |
| Reader Rabbit and the Fabulous Word Factory (14961)/ | 2026-01-04 14:12 | - | |
| Reaktionstest (11162)/ | 2026-01-04 14:12 | - | |
| Reakto (16415)/ | 2026-01-04 14:12 | - | |
| Real Carambola (14110)/ | 2026-01-04 14:12 | - | |
| Real Estate (11285)/ | 2026-01-04 14:12 | - | |
| Real Estate Tycoon (6245)/ | 2026-01-04 14:12 | - | |
| Real Ghostbusters, The (6246)/ | 2026-01-04 14:12 | - | |
| Real Poltergeist (6247)/ | 2026-01-04 14:12 | - | |
| Real Stunt Experts, The (6248)/ | 2026-01-04 14:12 | - | |
| Real Time Snap (13840)/ | 2026-01-04 14:12 | - | |
| Real You, The (16367)/ | 2026-01-04 14:12 | - | |
| Realm! (6253)/ | 2026-01-04 14:12 | - | |
| Realm, The (12595)/ | 2026-01-04 14:12 | - | |
| Realm of Darkness (9834)/ | 2026-01-04 14:12 | - | |
| Realm of Impossibility (6249)/ | 2026-01-04 14:12 | - | |
| Realm of Zaroc, The (6252)/ | 2026-01-04 14:12 | - | |
| Realm of the Trolls (2289)/ | 2026-01-04 14:12 | - | |
| Realm of the Undead (6250)/ | 2026-01-04 14:12 | - | |
| Realm of the Undead, The (6251)/ | 2026-01-04 14:12 | - | |
| Realms of Darkness (12270)/ | 2026-01-04 14:12 | - | |
| Rear Gunner (17357)/ | 2026-01-04 14:12 | - | |
| Reaxion (6254)/ | 2026-01-04 14:12 | - | |
| Reaxion Extended (14603)/ | 2026-01-04 14:12 | - | |
| Reaxion [Preview] (14454)/ | 2026-01-04 14:12 | - | |
| Rebel (6255)/ | 2026-01-04 14:12 | - | |
| Rebel (6256)/ | 2026-01-04 14:12 | - | |
| Rebel Bomber (10628)/ | 2026-01-04 14:12 | - | |
| Rebel Charge at Chickamauga (9861)/ | 2026-01-04 14:12 | - | |
| Rebel Force (9897)/ | 2026-01-04 14:12 | - | |
| Rebel Planet (6257)/ | 2026-01-04 14:12 | - | |
| Rebels and Lords (6258)/ | 2026-01-04 14:12 | - | |
| Rebound (6259)/ | 2026-01-04 14:12 | - | |
| Rebound (12070)/ | 2026-01-04 14:12 | - | |
| Rebound (12801)/ | 2026-01-04 14:12 | - | |
| Rechenloewe, Der - Fit in der Addition und Subtraktion (2.-3. Schuljahr) (16535)/ | 2026-01-04 14:12 | - | |
| Rechenloewe, Der - Fit in der Geometrie (3.-4. Schuljahr) (16536)/ | 2026-01-04 14:12 | - | |
| Rechenloewe, Der - Fit in der Mathematik (1. Schuljahr) (16537)/ | 2026-01-04 14:12 | - | |
| Rechenloewe, Der - Fit in der Multiplikation und Division (2.-3. Schuljahr) (16538)/ | 2026-01-04 14:12 | - | |
| Rechenloewe, Der - Fit in der Multiplikation und Division (3.-4. Schuljahr) (16539)/ | 2026-01-04 14:12 | - | |
| Rechne mal - Rate mal (12078)/ | 2026-01-04 14:12 | - | |
| Rechtschreibloewe, Der - Fit in der Rechtschreibung (3.-4.Schuljahr) (16540)/ | 2026-01-04 14:12 | - | |
| Reckless Rufus (6260)/ | 2026-01-04 14:12 | - | |
| Recog-Nice (6261)/ | 2026-01-04 14:12 | - | |
| Recoil (12219)/ | 2026-01-04 14:12 | - | |
| Recol (6262)/ | 2026-01-04 14:12 | - | |
| Recollect - A Game of Remembering (14283)/ | 2026-01-04 14:12 | - | |
| Recollect - A Game of Remembering (14393)/ | 2026-01-04 14:12 | - | |
| Recollect - A Game of Remembering (14422)/ | 2026-01-04 14:12 | - | |
| Recollect - A Game of Remembering (16702)/ | 2026-01-04 14:12 | - | |
| Recon [Preview] (6263)/ | 2026-01-04 14:12 | - | |
| Red (6264)/ | 2026-01-04 14:12 | - | |
| Red (14190)/ | 2026-01-04 14:12 | - | |
| Red 200 (6265)/ | 2026-01-04 14:12 | - | |
| Red Alert (6266)/ | 2026-01-04 14:12 | - | |
| Red Alert (6267)/ | 2026-01-04 14:12 | - | |
| Red Arrows (6268)/ | 2026-01-04 14:12 | - | |
| Red Baron (6269)/ | 2026-01-04 14:12 | - | |
| Red De Aarde (6270)/ | 2026-01-04 14:12 | - | |
| Red Dragon (16817)/ | 2026-01-04 14:12 | - | |
| Red Dust (6271)/ | 2026-01-04 14:12 | - | |
| Red Gum II (6272)/ | 2026-01-04 14:12 | - | |
| Red Heat (6273)/ | 2026-01-04 14:12 | - | |
| Red Heat (6274)/ | 2026-01-04 14:12 | - | |
| Red LED (6275)/ | 2026-01-04 14:12 | - | |
| Red Max (6276)/ | 2026-01-04 14:12 | - | |
| Red Moon (6277)/ | 2026-01-04 14:12 | - | |
| Red Obelisk, The (6278)/ | 2026-01-04 14:12 | - | |
| Red Planet, The (11627)/ | 2026-01-04 14:12 | - | |
| Red Sedan II (15816)/ | 2026-01-04 14:12 | - | |
| Red Storm Rising (6279)/ | 2026-01-04 14:12 | - | |
| Redhawk (6280)/ | 2026-01-04 14:12 | - | |
| Redheads - 47 Matches (12799)/ | 2026-01-04 14:12 | - | |
| Redics [Preview] (6281)/ | 2026-01-04 14:12 | - | |
| Reederei (6282)/ | 2026-01-04 14:12 | - | |
| Reederei (15454)/ | 2026-01-04 14:12 | - | |
| Reflect (6283)/ | 2026-01-04 14:12 | - | |
| Reflection (6284)/ | 2026-01-04 14:12 | - | |
| Reflex (11956)/ | 2026-01-04 14:12 | - | |
| Reflex, The (6285)/ | 2026-01-04 14:12 | - | |
| Reflex Bowling Alley (15821)/ | 2026-01-04 14:12 | - | |
| Reflexis (6286)/ | 2026-01-04 14:12 | - | |
| Regenspel (10234)/ | 2026-01-04 14:12 | - | |
| Regeszparbaj (15587)/ | 2026-01-04 14:12 | - | |
| Regieren (15908)/ | 2026-01-04 14:12 | - | |
| Regierung (14937)/ | 2026-01-04 14:12 | - | |
| Reich der Toten, Das (6287)/ | 2026-01-04 14:12 | - | |
| Reise nach Atlantis (6288)/ | 2026-01-04 14:12 | - | |
| Reisende im Wind (6289)/ | 2026-01-04 14:12 | - | |
| Reisende im Wind II (6290)/ | 2026-01-04 14:12 | - | |
| Reisespiel (15043)/ | 2026-01-04 14:12 | - | |
| Rejuvenator (12802)/ | 2026-01-04 14:12 | - | |
| Rekenwonder (6291)/ | 2026-01-04 14:12 | - | |
| Relax (6292)/ | 2026-01-04 14:12 | - | |
| Relax (6293)/ | 2026-01-04 14:12 | - | |
| Relaxed Motions (6294)/ | 2026-01-04 14:12 | - | |
| Rem Force [Preview] (6295)/ | 2026-01-04 14:12 | - | |
| Remember! (6297)/ | 2026-01-04 14:12 | - | |
| Remember (6296)/ | 2026-01-04 14:12 | - | |
| Remember It (14424)/ | 2026-01-04 14:12 | - | |
| Remembering (13974)/ | 2026-01-04 14:12 | - | |
| Rememory (9511)/ | 2026-01-04 14:12 | - | |
| Remote Control (6298)/ | 2026-01-04 14:12 | - | |
| Renaissance (6299)/ | 2026-01-04 14:12 | - | |
| Rendezvous (16247)/ | 2026-01-04 14:12 | - | |
| Rendezvous With Rama (6300)/ | 2026-01-04 14:12 | - | |
| Renegade (6301)/ | 2026-01-04 14:12 | - | |
| Renegade F-16 (6303)/ | 2026-01-04 14:12 | - | |
| Renegade III - The Final Chapter (6302)/ | 2026-01-04 14:12 | - | |
| Renegade Robot (11923)/ | 2026-01-04 14:12 | - | |
| Renegade Robot II (11875)/ | 2026-01-04 14:12 | - | |
| Repeat!! (6304)/ | 2026-01-04 14:12 | - | |
| Repeat the Sequence (11953)/ | 2026-01-04 14:12 | - | |
| Repel (6305)/ | 2026-01-04 14:12 | - | |
| Report (15870)/ | 2026-01-04 14:12 | - | |
| Report - Die Jagd nach einer guten Story (6306)/ | 2026-01-04 14:12 | - | |
| Repton (6307)/ | 2026-01-04 14:12 | - | |
| Repton III (6308)/ | 2026-01-04 14:12 | - | |
| Rescate (14191)/ | 2026-01-04 14:12 | - | |
| Rescate en la Montana (13906)/ | 2026-01-04 14:12 | - | |
| Rescue! (6315)/ | 2026-01-04 14:12 | - | |
| Rescue (15881)/ | 2026-01-04 14:12 | - | |
| Rescue (16859)/ | 2026-01-04 14:12 | - | |
| Rescue Mission (12803)/ | 2026-01-04 14:12 | - | |
| Rescue Mission (14261)/ | 2026-01-04 14:12 | - | |
| Rescue Pod (9333)/ | 2026-01-04 14:12 | - | |
| Rescue Squad (6313)/ | 2026-01-04 14:12 | - | |
| Rescue Stalingrad [Preview] (6314)/ | 2026-01-04 14:12 | - | |
| Rescue at Rana (6310)/ | 2026-01-04 14:12 | - | |
| Rescue of Blondell (10321)/ | 2026-01-04 14:12 | - | |
| Rescue on Fractalus! (6311)/ | 2026-01-04 14:12 | - | |
| Rescue on Fractalus! (6312)/ | 2026-01-04 14:12 | - | |
| Rescue on the Centauri (10360)/ | 2026-01-04 14:12 | - | |
| Resistencias (16243)/ | 2026-01-04 14:12 | - | |
| Retaliation (10842)/ | 2026-01-04 14:12 | - | |
| Retee! (14379)/ | 2026-01-04 14:12 | - | |
| Retour (11665)/ | 2026-01-04 14:12 | - | |
| Retro Ball (6316)/ | 2026-01-04 14:12 | - | |
| Retro Torque (6317)/ | 2026-01-04 14:12 | - | |
| Retrograde (6318)/ | 2026-01-04 14:12 | - | |
| Return of Heracles (13529)/ | 2026-01-04 14:12 | - | |
| Return of Paul, The (12804)/ | 2026-01-04 14:12 | - | |
| Return of Powerdash (9979)/ | 2026-01-04 14:12 | - | |
| Return of the Jedi (6319)/ | 2026-01-04 14:12 | - | |
| Return of the Lions [Preview] (6320)/ | 2026-01-04 14:12 | - | |
| Return of the Mutant Camels (6321)/ | 2026-01-04 14:12 | - | |
| Return of the Space Warriors (6322)/ | 2026-01-04 14:12 | - | |
| Return to Castle Dracula (10280)/ | 2026-01-04 14:12 | - | |
| Return to Earth (6323)/ | 2026-01-04 14:12 | - | |
| Return to Eden (6324)/ | 2026-01-04 14:12 | - | |
| Return to Firgamica (16798)/ | 2026-01-04 14:12 | - | |
| Return to Karven (10713)/ | 2026-01-04 14:12 | - | |
| Return to Oz (6325)/ | 2026-01-04 14:12 | - | |
| Return to the Homecastle! (15261)/ | 2026-01-04 14:12 | - | |
| Reuter's World (6326)/ | 2026-01-04 14:12 | - | |
| Revange of the Power-Worm, The (9334)/ | 2026-01-04 14:12 | - | |
| Revarsi (16409)/ | 2026-01-04 14:12 | - | |
| Revelation (6327)/ | 2026-01-04 14:12 | - | |
| Revenge! (16364)/ | 2026-01-04 14:12 | - | |
| Revenge 1.1 (16818)/ | 2026-01-04 14:12 | - | |
| Revenge Adventure (10300)/ | 2026-01-04 14:12 | - | |
| Revenge [Preview] (9760)/ | 2026-01-04 14:12 | - | |
| Revenge is Sweet (16365)/ | 2026-01-04 14:12 | - | |
| Revenge of Balrog (6328)/ | 2026-01-04 14:12 | - | |
| Revenge of Cyon (6329)/ | 2026-01-04 14:12 | - | |
| Revenge of Defender (9296)/ | 2026-01-04 14:12 | - | |
| Revenge of the Moon Goddess (6330)/ | 2026-01-04 14:12 | - | |
| Revenge of the Mutant Camels (6331)/ | 2026-01-04 14:12 | - | |
| Revenge of the Phoenix (6332)/ | 2026-01-04 14:12 | - | |
| Revenge of the Toothless Vampire (6333)/ | 2026-01-04 14:12 | - | |
| Revenger (12809)/ | 2026-01-04 14:12 | - | |
| Reverberations (12811)/ | 2026-01-04 14:12 | - | |
| Reversi (6334)/ | 2026-01-04 14:12 | - | |
| Reversi (6335)/ | 2026-01-04 14:12 | - | |
| Reversi (9742)/ | 2026-01-04 14:12 | - | |
| Reversi (10934)/ | 2026-01-04 14:12 | - | |
| Reversi (12810)/ | 2026-01-04 14:12 | - | |
| Reversi (13649)/ | 2026-01-04 14:12 | - | |
| Reversi (15767)/ | 2026-01-04 14:12 | - | |
| Reversi (15899)/ | 2026-01-04 14:12 | - | |
| Reversi GTI (6336)/ | 2026-01-04 14:12 | - | |
| Reversie (15069)/ | 2026-01-04 14:12 | - | |
| Reversie (16182)/ | 2026-01-04 14:12 | - | |
| Revolution (6337)/ | 2026-01-04 14:12 | - | |
| Revolverheld (6338)/ | 2026-01-04 14:12 | - | |
| Revs (6339)/ | 2026-01-04 14:12 | - | |
| Revs+ (6340)/ | 2026-01-04 14:12 | - | |
| Rex I (6341)/ | 2026-01-04 14:12 | - | |
| Rhyme Concentration (13976)/ | 2026-01-04 14:12 | - | |
| Rhymes & Riddles (16435)/ | 2026-01-04 14:12 | - | |
| Ricachet (16059)/ | 2026-01-04 14:12 | - | |
| Richard Petty's Talladega (6342)/ | 2026-01-04 14:12 | - | |
| Richtofen's Revenge (6343)/ | 2026-01-04 14:12 | - | |
| Rick Dangerous (6344)/ | 2026-01-04 14:12 | - | |
| Rick Dangerous II (6345)/ | 2026-01-04 14:12 | - | |
| Ricochet (6346)/ | 2026-01-04 14:12 | - | |
| Ricochet (12241)/ | 2026-01-04 14:12 | - | |
| Ricochet Maze (12819)/ | 2026-01-04 14:12 | - | |
| Ricochet Muncher (11886)/ | 2026-01-04 14:12 | - | |
| Riddle of the Redstone (6347)/ | 2026-01-04 14:12 | - | |
| Riddles and Stones (6348)/ | 2026-01-04 14:12 | - | |
| Riddles of Herne (16675)/ | 2026-01-04 14:12 | - | |
| Riding the Boards (17134)/ | 2026-01-04 14:12 | - | |
| Rigel's Revenge (6349)/ | 2026-01-04 14:12 | - | |
| Rigor [Preview] (6350)/ | 2026-01-04 14:12 | - | |
| Rij Test (9231)/ | 2026-01-04 14:12 | - | |
| Riki Tiki 64 (6352)/ | 2026-01-04 14:12 | - | |
| Rik the Roadie (6351)/ | 2026-01-04 14:12 | - | |
| Rim Raiders (9157)/ | 2026-01-04 14:12 | - | |
| Rimrunner (6353)/ | 2026-01-04 14:12 | - | |
| Ring Master (6354)/ | 2026-01-04 14:12 | - | |
| Ringo (6356)/ | 2026-01-04 14:12 | - | |
| Ring of Elanor, The (16874)/ | 2026-01-04 14:12 | - | |
| Ring of Power, The (6355)/ | 2026-01-04 14:12 | - | |
| Rings'n'Up (6357)/ | 2026-01-04 14:12 | - | |
| Ringside (6360)/ | 2026-01-04 14:12 | - | |
| Ringside Boxing (6361)/ | 2026-01-04 14:12 | - | |
| Ringside Boxing (6362)/ | 2026-01-04 14:12 | - | |
| Ringside Karate (6363)/ | 2026-01-04 14:12 | - | |
| Ringside Seat (12178)/ | 2026-01-04 14:12 | - | |
| Rings of Medusa (6358)/ | 2026-01-04 14:12 | - | |
| Rings of Medusa (9863)/ | 2026-01-04 14:12 | - | |
| Rings of Zilfin (6359)/ | 2026-01-04 14:12 | - | |
| Ringwars (6364)/ | 2026-01-04 14:12 | - | |
| Ripper! (6365)/ | 2026-01-04 14:12 | - | |
| Risers & Sliders (6366)/ | 2026-01-04 14:12 | - | |
| Risicom 64 (10833)/ | 2026-01-04 14:12 | - | |
| Risiko (6367)/ | 2026-01-04 14:12 | - | |
| Risiko (6368)/ | 2026-01-04 14:12 | - | |
| Risiko Super (15728)/ | 2026-01-04 14:12 | - | |
| Risk! [Preview] (10980)/ | 2026-01-04 14:12 | - | |
| Risk (6370)/ | 2026-01-04 14:12 | - | |
| Risk (6372)/ | 2026-01-04 14:12 | - | |
| Risk (15346)/ | 2026-01-04 14:12 | - | |
| Risk - Cassette Edition (6373)/ | 2026-01-04 14:12 | - | |
| Risk - Disk Edition (6371)/ | 2026-01-04 14:12 | - | |
| Riskant (6374)/ | 2026-01-04 14:12 | - | |
| Riskant II (9288)/ | 2026-01-04 14:12 | - | |
| Rites of Passage (10293)/ | 2026-01-04 14:12 | - | |
| Ritter (6375)/ | 2026-01-04 14:12 | - | |
| Ritter Erik (15670)/ | 2026-01-04 14:12 | - | |
| Ritter der Mueslirunde, Der (9247)/ | 2026-01-04 14:12 | - | |
| River-Raid II - The River Patrol (6380)/ | 2026-01-04 14:12 | - | |
| River Chase (6376)/ | 2026-01-04 14:12 | - | |
| River Crossing (15700)/ | 2026-01-04 14:12 | - | |
| River Mission (6377)/ | 2026-01-04 14:12 | - | |
| River Patrol, The (13558)/ | 2026-01-04 14:12 | - | |
| River Raid (6379)/ | 2026-01-04 14:12 | - | |
| River Raid 64 (13651)/ | 2026-01-04 14:12 | - | |
| River Rescue (6381)/ | 2026-01-04 14:12 | - | |
| River Run (12373)/ | 2026-01-04 14:12 | - | |
| River of no Return (6378)/ | 2026-01-04 14:12 | - | |
| Riverside Kingdom (12805)/ | 2026-01-04 14:12 | - | |
| Rivolta, La (14101)/ | 2026-01-04 14:12 | - | |
| Riziko (13440)/ | 2026-01-04 14:12 | - | |
| Roach Race (15708)/ | 2026-01-04 14:12 | - | |
| RoadBlasters (6395)/ | 2026-01-04 14:12 | - | |
| Road Cop (16976)/ | 2026-01-04 14:12 | - | |
| Road Course (6384)/ | 2026-01-04 14:12 | - | |
| Road Duels - The Corvette (6385)/ | 2026-01-04 14:12 | - | |
| Road Hogs (16977)/ | 2026-01-04 14:12 | - | |
| Road King (6386)/ | 2026-01-04 14:12 | - | |
| Road Patrol (14575)/ | 2026-01-04 14:12 | - | |
| Road Police (16978)/ | 2026-01-04 14:12 | - | |
| Road Race (12229)/ | 2026-01-04 14:12 | - | |
| Road Race (15951)/ | 2026-01-04 14:12 | - | |
| Road Racer (12201)/ | 2026-01-04 14:12 | - | |
| Road Raiders (6387)/ | 2026-01-04 14:12 | - | |
| Road Rally (6388)/ | 2026-01-04 14:12 | - | |
| Road Rally USA (17130)/ | 2026-01-04 14:12 | - | |
| Road Roller (6389)/ | 2026-01-04 14:12 | - | |
| Road Runner (6390)/ | 2026-01-04 14:12 | - | |
| Road Runner and Wile E. Coyote (6391)/ | 2026-01-04 14:12 | - | |
| Road Toad (6393)/ | 2026-01-04 14:12 | - | |
| Road Warrior (6394)/ | 2026-01-04 14:12 | - | |
| Roadblock-64 (12820)/ | 2026-01-04 14:12 | - | |
| Roadburner (6396)/ | 2026-01-04 14:12 | - | |
| Roader (10204)/ | 2026-01-04 14:12 | - | |
| Roadhog (12821)/ | 2026-01-04 14:12 | - | |
| Roadkiller (14015)/ | 2026-01-04 14:12 | - | |
| Roadrace (6397)/ | 2026-01-04 14:12 | - | |
| Road to Moscow (6392)/ | 2026-01-04 14:12 | - | |
| Roadtoad (13703)/ | 2026-01-04 14:12 | - | |
| Roadwar 2000 (6398)/ | 2026-01-04 14:12 | - | |
| Roadwar Europa (6399)/ | 2026-01-04 14:12 | - | |
| Roadwars (6400)/ | 2026-01-04 14:12 | - | |
| Roar (11146)/ | 2026-01-04 14:12 | - | |
| Robber & Cop (14919)/ | 2026-01-04 14:12 | - | |
| Robbers of the Lost Tomb (6401)/ | 2026-01-04 14:12 | - | |
| Robbo (6402)/ | 2026-01-04 14:12 | - | |
| Robby (6403)/ | 2026-01-04 14:12 | - | |
| Robby-Chess 2.0 (6404)/ | 2026-01-04 14:12 | - | |
| Robert Robert (14192)/ | 2026-01-04 14:12 | - | |
| Robin Back - Robin Hood II (6405)/ | 2026-01-04 14:12 | - | |
| Robin Hood's Gold (11095)/ | 2026-01-04 14:12 | - | |
| Robin Hood (6406)/ | 2026-01-04 14:12 | - | |
| Robin Hood (9100)/ | 2026-01-04 14:12 | - | |
| Robin Hood - Der Held von Sherwood (15077)/ | 2026-01-04 14:12 | - | |
| Robin Hood - Legend Quest (6407)/ | 2026-01-04 14:12 | - | |
| Robin II (14193)/ | 2026-01-04 14:12 | - | |
| Robin Smith's International Cricket (6410)/ | 2026-01-04 14:12 | - | |
| Robin of Sherwood - The Touchstones of Rhiannon (6408)/ | 2026-01-04 14:12 | - | |
| Robin of the Wood (6409)/ | 2026-01-04 14:12 | - | |
| Robin to the Rescue (6411)/ | 2026-01-04 14:12 | - | |
| Robo's Revenge (6413)/ | 2026-01-04 14:12 | - | |
| Robo (12410)/ | 2026-01-04 14:12 | - | |
| Robo-City (10292)/ | 2026-01-04 14:12 | - | |
| RoboCop (6415)/ | 2026-01-04 14:12 | - | |
| RoboCop II (6416)/ | 2026-01-04 14:12 | - | |
| RoboCop III (6417)/ | 2026-01-04 14:12 | - | |
| Robo Raid (10797)/ | 2026-01-04 14:12 | - | |
| Robo Runner (6412)/ | 2026-01-04 14:12 | - | |
| Robobolt (6414)/ | 2026-01-04 14:12 | - | |
| Robodive (15807)/ | 2026-01-04 14:12 | - | |
| Roboservant (6418)/ | 2026-01-04 14:12 | - | |
| Robospy (16248)/ | 2026-01-04 14:12 | - | |
| Robot (10780)/ | 2026-01-04 14:12 | - | |
| Robot (16856)/ | 2026-01-04 14:12 | - | |
| Robot Attack (12818)/ | 2026-01-04 14:12 | - | |
| Robot Craze (16305)/ | 2026-01-04 14:12 | - | |
| Robot Invaders (17328)/ | 2026-01-04 14:12 | - | |
| Robot Math (6419)/ | 2026-01-04 14:12 | - | |
| Robot Missile (17313)/ | 2026-01-04 14:12 | - | |
| Robot Raider (6420)/ | 2026-01-04 14:12 | - | |
| Robot Rascals - A Zany Scavenger Hunt (6421)/ | 2026-01-04 14:12 | - | |
| Robot Rascals - A Zany Scavenger Hunt (14622)/ | 2026-01-04 14:12 | - | |
| Robot Rescue (14307)/ | 2026-01-04 14:12 | - | |
| Robot Run (11141)/ | 2026-01-04 14:12 | - | |
| Robot Runner (6422)/ | 2026-01-04 14:12 | - | |
| Robot Traxx (14113)/ | 2026-01-04 14:12 | - | |
| Robotank (6423)/ | 2026-01-04 14:12 | - | |
| Roboterangriff (13806)/ | 2026-01-04 14:12 | - | |
| Robotron (6425)/ | 2026-01-04 14:12 | - | |
| Robotron - 2084 (6426)/ | 2026-01-04 14:12 | - | |
| Robotronix [Preview] (6427)/ | 2026-01-04 14:12 | - | |
| Robots of Dawn (6428)/ | 2026-01-04 14:12 | - | |
| Robots of Xerxes (12822)/ | 2026-01-04 14:12 | - | |
| Robowar (12565)/ | 2026-01-04 14:12 | - | |
| Robox (6429)/ | 2026-01-04 14:12 | - | |
| Robox (6430)/ | 2026-01-04 14:12 | - | |
| Robox (12806)/ | 2026-01-04 14:12 | - | |
| Robozone (6431)/ | 2026-01-04 14:12 | - | |
| Rock'n Roll (6437)/ | 2026-01-04 14:12 | - | |
| Rock'n Roll Fahnder (6438)/ | 2026-01-04 14:12 | - | |
| Rock'n Rope (6439)/ | 2026-01-04 14:12 | - | |
| Rock'n Wrestle (6440)/ | 2026-01-04 14:12 | - | |
| Rock Fall (6432)/ | 2026-01-04 14:12 | - | |
| Rock Fall (15965)/ | 2026-01-04 14:12 | - | |
| Rock Paper Scissors (12817)/ | 2026-01-04 14:12 | - | |
| Rock Paper Shear (6434)/ | 2026-01-04 14:12 | - | |
| Rock Run (6435)/ | 2026-01-04 14:12 | - | |
| Rock Star (17595)/ | 2026-01-04 14:12 | - | |
| Rock Star Ate my Hamster, A (6436)/ | 2026-01-04 14:12 | - | |
| Rocket (15597)/ | 2026-01-04 14:12 | - | |
| Rocket Ball (6441)/ | 2026-01-04 14:12 | - | |
| Rocket Launch (9404)/ | 2026-01-04 14:12 | - | |
| Rocket Man (16843)/ | 2026-01-04 14:12 | - | |
| Rocket Ranger (6442)/ | 2026-01-04 14:12 | - | |
| Rocket Roger (6443)/ | 2026-01-04 14:12 | - | |
| Rockfall (12807)/ | 2026-01-04 14:12 | - | |
| Rockfall II (12808)/ | 2026-01-04 14:12 | - | |
| Rockford (6445)/ | 2026-01-04 14:12 | - | |
| Rocki Rockano in Lolliland (12166)/ | 2026-01-04 14:12 | - | |
| Rockman (14222)/ | 2026-01-04 14:12 | - | |
| Rock n' Bolt (6433)/ | 2026-01-04 14:12 | - | |
| Rocky's Boots (6447)/ | 2026-01-04 14:12 | - | |
| Rocky (9426)/ | 2026-01-04 14:12 | - | |
| Rocky (14194)/ | 2026-01-04 14:12 | - | |
| Rocky Horror Show, The (6446)/ | 2026-01-04 14:12 | - | |
| Rocky Island (16979)/ | 2026-01-04 14:12 | - | |
| Rodex I (9996)/ | 2026-01-04 14:12 | - | |
| Rodex II (9997)/ | 2026-01-04 14:12 | - | |
| Rodex III (9998)/ | 2026-01-04 14:12 | - | |
| Rodex IV (9999)/ | 2026-01-04 14:12 | - | |
| Rodex V (10000)/ | 2026-01-04 14:12 | - | |
| Rodland (6448)/ | 2026-01-04 14:12 | - | |
| Rodney the Droid (16209)/ | 2026-01-04 14:12 | - | |
| Rodney to the Rescue (12419)/ | 2026-01-04 14:12 | - | |
| Roesselsprung (12094)/ | 2026-01-04 14:12 | - | |
| Rogue (6449)/ | 2026-01-04 14:12 | - | |
| Rogue Comet (10291)/ | 2026-01-04 14:12 | - | |
| Rogue Sunbathers (6450)/ | 2026-01-04 14:12 | - | |
| Rogue Trooper (6451)/ | 2026-01-04 14:12 | - | |
| Rogue the Dog! (10772)/ | 2026-01-04 14:12 | - | |
| Roland's Ratrace (6452)/ | 2026-01-04 14:12 | - | |
| Roll 'em (11417)/ | 2026-01-04 14:12 | - | |
| Roll-About (6455)/ | 2026-01-04 14:12 | - | |
| Roll Call (16579)/ | 2026-01-04 14:12 | - | |
| Roll Call USA (10233)/ | 2026-01-04 14:12 | - | |
| Roll It (6453)/ | 2026-01-04 14:12 | - | |
| Roll Off (13426)/ | 2026-01-04 14:12 | - | |
| Roll Over (6454)/ | 2026-01-04 14:12 | - | |
| Rollan Football (10073)/ | 2026-01-04 14:12 | - | |
| Rollaround (6456)/ | 2026-01-04 14:12 | - | |
| Rolled Oats (9155)/ | 2026-01-04 14:12 | - | |
| Rollende Panzer (15282)/ | 2026-01-04 14:12 | - | |
| Roller (6457)/ | 2026-01-04 14:12 | - | |
| RollerBall (6458)/ | 2026-01-04 14:12 | - | |
| Roller Ball (9887)/ | 2026-01-04 14:12 | - | |
| Rollerboard (6460)/ | 2026-01-04 14:12 | - | |
| Rollerboy (6461)/ | 2026-01-04 14:12 | - | |
| Rollercoaster (6462)/ | 2026-01-04 14:12 | - | |
| Rollercoaster Rumbler (6463)/ | 2026-01-04 14:12 | - | |
| Rollerdash (12231)/ | 2026-01-04 14:12 | - | |
| Rolli Kong (17363)/ | 2026-01-04 14:12 | - | |
| Rollin (6464)/ | 2026-01-04 14:12 | - | |
| Rollin (6465)/ | 2026-01-04 14:12 | - | |
| Rolling Ronny (6466)/ | 2026-01-04 14:12 | - | |
| Rolling Thunder (6467)/ | 2026-01-04 14:12 | - | |
| Rolling Twins (6468)/ | 2026-01-04 14:12 | - | |
| Rollingo (14082)/ | 2026-01-04 14:12 | - | |
| Rolloverture (6469)/ | 2026-01-04 14:12 | - | |
| Rolodash 1 (12154)/ | 2026-01-04 14:12 | - | |
| Rolodash 2 (12155)/ | 2026-01-04 14:12 | - | |
| Roloid (6470)/ | 2026-01-04 14:12 | - | |
| Roman Empire (12814)/ | 2026-01-04 14:12 | - | |
| Roman Numerals (6471)/ | 2026-01-04 14:12 | - | |
| Roman Numerals (14408)/ | 2026-01-04 14:12 | - | |
| Roman Numerals (16690)/ | 2026-01-04 14:12 | - | |
| Rombus Attack (6472)/ | 2026-01-04 14:12 | - | |
| Rome and the Barbarian (6473)/ | 2026-01-04 14:12 | - | |
| Romeo & Juliet (13977)/ | 2026-01-04 14:12 | - | |
| Rommel - Battles for North Africa (11206)/ | 2026-01-04 14:12 | - | |
| Romper Room's I Love my Alphabet (6474)/ | 2026-01-04 14:12 | - | |
| Romulus (6475)/ | 2026-01-04 14:12 | - | |
| Ronald Rubberduck (6476)/ | 2026-01-04 14:12 | - | |
| Roofus (6477)/ | 2026-01-04 14:12 | - | |
| Room Ten (6478)/ | 2026-01-04 14:12 | - | |
| Roomlord (6479)/ | 2026-01-04 14:12 | - | |
| Rooms (9090)/ | 2026-01-04 14:12 | - | |
| Rooms of the Lost Jewel (10290)/ | 2026-01-04 14:12 | - | |
| Root Race (6480)/ | 2026-01-04 14:12 | - | |
| Rooter (6481)/ | 2026-01-04 14:12 | - | |
| Rootin' Tootin' (6482)/ | 2026-01-04 14:12 | - | |
| Rostam & Esfandiar (16727)/ | 2026-01-04 14:12 | - | |
| Rotamint (11090)/ | 2026-01-04 14:12 | - | |
| Rotate! (16094)/ | 2026-01-04 14:12 | - | |
| Rotate (10232)/ | 2026-01-04 14:12 | - | |
| Rotation Craze (6483)/ | 2026-01-04 14:12 | - | |
| Rotations (6484)/ | 2026-01-04 14:12 | - | |
| Rotationsspiel (16432)/ | 2026-01-04 14:12 | - | |
| Rotato Poker (13402)/ | 2026-01-04 14:12 | - | |
| Rotator (16758)/ | 2026-01-04 14:12 | - | |
| Rote Mondstein, Der (14950)/ | 2026-01-04 14:12 | - | |
| Roue de la Fortune, La (12266)/ | 2026-01-04 14:12 | - | |
| Rouge Midget II - Return of the Scarlet Shortguy (10715)/ | 2026-01-04 14:12 | - | |
| Rouge et Noir (16648)/ | 2026-01-04 14:12 | - | |
| Rough Commando (6485)/ | 2026-01-04 14:12 | - | |
| Rough House 21 (12034)/ | 2026-01-04 14:12 | - | |
| Rough Justice (15090)/ | 2026-01-04 14:12 | - | |
| Roulder Dash 1 (16792)/ | 2026-01-04 14:12 | - | |
| Roulder Dash 2 (16793)/ | 2026-01-04 14:12 | - | |
| Roulett (11640)/ | 2026-01-04 14:12 | - | |
| Roulett (14719)/ | 2026-01-04 14:12 | - | |
| Roulette (6486)/ | 2026-01-04 14:12 | - | |
| Roulette (6487)/ | 2026-01-04 14:12 | - | |
| Roulette (9625)/ | 2026-01-04 14:12 | - | |
| Roulette (11175)/ | 2026-01-04 14:12 | - | |
| Roulette (11619)/ | 2026-01-04 14:12 | - | |
| Roulette (13449)/ | 2026-01-04 14:12 | - | |
| Roulette (14660)/ | 2026-01-04 14:12 | - | |
| Roulette (14709)/ | 2026-01-04 14:12 | - | |
| Roulette (15514)/ | 2026-01-04 14:12 | - | |
| Roulette (15754)/ | 2026-01-04 14:12 | - | |
| Roulette (16227)/ | 2026-01-04 14:12 | - | |
| Roulette Simulator (6488)/ | 2026-01-04 14:12 | - | |
| Roulette Wheel (15847)/ | 2026-01-04 14:12 | - | |
| Round About (6489)/ | 2026-01-04 14:12 | - | |
| RoundAbout (16012)/ | 2026-01-04 14:12 | - | |
| Round Robin (12663)/ | 2026-01-04 14:12 | - | |
| Roundabout (6492)/ | 2026-01-04 14:12 | - | |
| Round the Bend! (6490)/ | 2026-01-04 14:12 | - | |
| Round the Bend! II [Preview] (6491)/ | 2026-01-04 14:12 | - | |
| Row Boat (9821)/ | 2026-01-04 14:12 | - | |
| Row Regatta (12812)/ | 2026-01-04 14:12 | - | |
| Rowdy (6493)/ | 2026-01-04 14:12 | - | |
| Rowly (6494)/ | 2026-01-04 14:12 | - | |
| Rox (13832)/ | 2026-01-04 14:12 | - | |
| Rox-64 (9489)/ | 2026-01-04 14:12 | - | |
| Rox 64 (6495)/ | 2026-01-04 14:12 | - | |
| Royal Pain (16636)/ | 2026-01-04 14:12 | - | |
| Royal Rescue (6497)/ | 2026-01-04 14:12 | - | |
| Royal Scot (12815)/ | 2026-01-04 14:12 | - | |
| Roy of the Rovers (6496)/ | 2026-01-04 14:12 | - | |
| Rubber Bandit Ball (12116)/ | 2026-01-04 14:12 | - | |
| Rubbish Monster (6498)/ | 2026-01-04 14:12 | - | |
| Rubicon (6499)/ | 2026-01-04 14:12 | - | |
| Rubicon Alliance, The (13669)/ | 2026-01-04 14:12 | - | |
| Rubik's Cube (12816)/ | 2026-01-04 14:12 | - | |
| Rubik's Cube (13454)/ | 2026-01-04 14:12 | - | |
| Rubint, A (13442)/ | 2026-01-04 14:12 | - | |
| Rudi the Rat (6500)/ | 2026-01-04 14:12 | - | |
| Ruff and Reddy (6501)/ | 2026-01-04 14:12 | - | |
| Rug Rider (6502)/ | 2026-01-04 14:12 | - | |
| Rugby - The World Cup (6503)/ | 2026-01-04 14:12 | - | |
| Rugby Boss (6504)/ | 2026-01-04 14:12 | - | |
| Rugby Coach (6505)/ | 2026-01-04 14:12 | - | |
| Rugby League Manager (6506)/ | 2026-01-04 14:12 | - | |
| Ruine Eckstein (9256)/ | 2026-01-04 14:12 | - | |
| Ruin of Xerx (15447)/ | 2026-01-04 14:12 | - | |
| Ruler (13978)/ | 2026-01-04 14:12 | - | |
| Ruler (14488)/ | 2026-01-04 14:12 | - | |
| Ruler Machine (9132)/ | 2026-01-04 14:12 | - | |
| Ruleta (14195)/ | 2026-01-04 14:12 | - | |
| Rule the Kingdom (6507)/ | 2026-01-04 14:12 | - | |
| Rulette (13979)/ | 2026-01-04 14:12 | - | |
| Rumball (12813)/ | 2026-01-04 14:12 | - | |
| Run, The (6515)/ | 2026-01-04 14:12 | - | |
| Run Harry (14545)/ | 2026-01-04 14:12 | - | |
| Run Like Hell (6512)/ | 2026-01-04 14:12 | - | |
| Run Riki Run (6513)/ | 2026-01-04 14:12 | - | |
| Runaway (6516)/ | 2026-01-04 14:12 | - | |
| Runaway (6517)/ | 2026-01-04 14:12 | - | |
| Rundes Leder (6518)/ | 2026-01-04 14:12 | - | |
| Rundes Leder (14438)/ | 2026-01-04 14:12 | - | |
| Rune (16684)/ | 2026-01-04 14:12 | - | |
| Runequest (15794)/ | 2026-01-04 14:12 | - | |
| Runestone [Preview] (10608)/ | 2026-01-04 14:12 | - | |
| Runestones (10080)/ | 2026-01-04 14:12 | - | |
| Runfill (15759)/ | 2026-01-04 14:12 | - | |
| Run for Diamonds (6508)/ | 2026-01-04 14:12 | - | |
| Run for Diamonds II (6509)/ | 2026-01-04 14:12 | - | |
| Run for Gold (6510)/ | 2026-01-04 14:12 | - | |
| Run for the Money (6511)/ | 2026-01-04 14:12 | - | |
| Runman Construction Set (10452)/ | 2026-01-04 14:12 | - | |
| Runner (6519)/ | 2026-01-04 14:12 | - | |
| Runner (14196)/ | 2026-01-04 14:12 | - | |
| Running Balls (6520)/ | 2026-01-04 14:12 | - | |
| Running Biblets (16980)/ | 2026-01-04 14:12 | - | |
| Running Man, The (6521)/ | 2026-01-04 14:12 | - | |
| Run the Gauntlet (6514)/ | 2026-01-04 14:12 | - | |
| Run to Goldy (14670)/ | 2026-01-04 14:12 | - | |
| Runway 64 (6522)/ | 2026-01-04 14:12 | - | |
| Ruote Corazzate (14111)/ | 2026-01-04 14:12 | - | |
| Rupert and the Ice Castle (6523)/ | 2026-01-04 14:12 | - | |
| Rupert and the Toymaker's Party (6524)/ | 2026-01-04 14:12 | - | |
| Rush'n Attack (6525)/ | 2026-01-04 14:12 | - | |
| Rush Hour (6526)/ | 2026-01-04 14:12 | - | |
| Russia (6527)/ | 2026-01-04 14:12 | - | |
| Russian Roulette (9640)/ | 2026-01-04 14:12 | - | |
| Russian Roulette (15703)/ | 2026-01-04 14:12 | - | |
| Russisch Roulette (11646)/ | 2026-01-04 14:12 | - | |
| Rygar (6528)/ | 2026-01-04 14:12 | - | |
| Ryshka (6529)/ | 2026-01-04 14:12 | - | |
|
|---|