![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | HATE (3432)/ | 2026-01-04 14:11 | - | |
| HERO - Helicopter Emergency Rescue Operation (3508)/ | 2026-01-04 14:11 | - | |
| HES Games (3517)/ | 2026-01-04 14:11 | - | |
| Hacker (3371)/ | 2026-01-04 14:11 | - | |
| Hacker 2001 (3372)/ | 2026-01-04 14:11 | - | |
| Hacker II - The Doomsday Papers (3373)/ | 2026-01-04 14:11 | - | |
| Hacker II - The Doomsday Papers (3374)/ | 2026-01-04 14:11 | - | |
| Hackman! (11762)/ | 2026-01-04 14:11 | - | |
| Hades (3375)/ | 2026-01-04 14:11 | - | |
| Hades Nebula (3376)/ | 2026-01-04 14:11 | - | |
| Haegar der Schreckliche (3377)/ | 2026-01-04 14:11 | - | |
| Haendler des Morgenlandes (3378)/ | 2026-01-04 14:11 | - | |
| Haengemathe (14240)/ | 2026-01-04 14:11 | - | |
| Haeuptling Majestix (15122)/ | 2026-01-04 14:11 | - | |
| Hagar the Horrible (11758)/ | 2026-01-04 14:11 | - | |
| Hagl (3379)/ | 2026-01-04 14:11 | - | |
| Hail (16699)/ | 2026-01-04 14:11 | - | |
| Halalsziget (17394)/ | 2026-01-04 14:11 | - | |
| Halcyon (3380)/ | 2026-01-04 14:11 | - | |
| Halftime Battlin' Bands (13395)/ | 2026-01-04 14:11 | - | |
| Halifax (3381)/ | 2026-01-04 14:11 | - | |
| Hallax (3382)/ | 2026-01-04 14:11 | - | |
| Halley Mission, The - A Shuttle Simulation (9123)/ | 2026-01-04 14:11 | - | |
| Halley Project, The (3383)/ | 2026-01-04 14:11 | - | |
| Halloween (3384)/ | 2026-01-04 14:11 | - | |
| Halloween Police (10197)/ | 2026-01-04 14:11 | - | |
| Halls of Death (3385)/ | 2026-01-04 14:11 | - | |
| Halls of Montezuma (9847)/ | 2026-01-04 14:11 | - | |
| Halls of the Dwarven Kings, The (10824)/ | 2026-01-04 14:11 | - | |
| Halls of the Things, The (3386)/ | 2026-01-04 14:11 | - | |
| Haloween (16945)/ | 2026-01-04 14:11 | - | |
| Hals und Beinbruch (3387)/ | 2026-01-04 14:11 | - | |
| Halving the Ton (15835)/ | 2026-01-04 14:11 | - | |
| Hammarubi (3388)/ | 2026-01-04 14:11 | - | |
| Hammer! (3389)/ | 2026-01-04 14:11 | - | |
| Hammer Boy (3390)/ | 2026-01-04 14:11 | - | |
| Hammer Bros! (11765)/ | 2026-01-04 14:11 | - | |
| Hammer Yammer (15811)/ | 2026-01-04 14:11 | - | |
| Hammerfist (3391)/ | 2026-01-04 14:11 | - | |
| Hammer of Grimmold (11341)/ | 2026-01-04 14:11 | - | |
| Hammurabi (3392)/ | 2026-01-04 14:11 | - | |
| Hampstead (3393)/ | 2026-01-04 14:11 | - | |
| Hamurabi (11236)/ | 2026-01-04 14:11 | - | |
| Hamurabi (15718)/ | 2026-01-04 14:11 | - | |
| Hamurabi von Babylon (11017)/ | 2026-01-04 14:11 | - | |
| Handball (11766)/ | 2026-01-04 14:11 | - | |
| Handel (3394)/ | 2026-01-04 14:11 | - | |
| Handel (10134)/ | 2026-01-04 14:11 | - | |
| Handelsspiel (16422)/ | 2026-01-04 14:11 | - | |
| Handicap Golf (3395)/ | 2026-01-04 14:11 | - | |
| Hand of Doom, The (9089)/ | 2026-01-04 14:11 | - | |
| Handvoll Dollar$, Eine (16220)/ | 2026-01-04 14:11 | - | |
| Hang-Man (12125)/ | 2026-01-04 14:11 | - | |
| Hang-Math (11768)/ | 2026-01-04 14:11 | - | |
| Hang 1K (17084)/ | 2026-01-04 14:11 | - | |
| Hang Man (11237)/ | 2026-01-04 14:11 | - | |
| Hang Over (3396)/ | 2026-01-04 14:11 | - | |
| Hanger 14 (9755)/ | 2026-01-04 14:11 | - | |
| Hangman #006 (13194)/ | 2026-01-04 14:11 | - | |
| Hangman #007 (14394)/ | 2026-01-04 14:11 | - | |
| Hangman #008 (14421)/ | 2026-01-04 14:11 | - | |
| Hangman #009 (16698)/ | 2026-01-04 14:11 | - | |
| Hangman #010 (14284)/ | 2026-01-04 14:11 | - | |
| Hangman #011 (14285)/ | 2026-01-04 14:11 | - | |
| Hangman (3397)/ | 2026-01-04 14:11 | - | |
| Hangman (3398)/ | 2026-01-04 14:11 | - | |
| Hangman (9173)/ | 2026-01-04 14:11 | - | |
| Hangman (9385)/ | 2026-01-04 14:11 | - | |
| Hangman (9482)/ | 2026-01-04 14:11 | - | |
| Hangman (11240)/ | 2026-01-04 14:11 | - | |
| Hangman (14544)/ | 2026-01-04 14:11 | - | |
| Hangman (14656)/ | 2026-01-04 14:11 | - | |
| Hangman (15374)/ | 2026-01-04 14:11 | - | |
| Hangman (15744)/ | 2026-01-04 14:11 | - | |
| Hangman (16616)/ | 2026-01-04 14:11 | - | |
| Hangman (17348)/ | 2026-01-04 14:11 | - | |
| Hangman (17682)/ | 2026-01-04 14:11 | - | |
| Hangman 64 (3399)/ | 2026-01-04 14:11 | - | |
| Hangman Deluxe [Preview] (3400)/ | 2026-01-04 14:11 | - | |
| Hangman I (11835)/ | 2026-01-04 14:11 | - | |
| Hangman II (3401)/ | 2026-01-04 14:11 | - | |
| Hangman II (13488)/ | 2026-01-04 14:11 | - | |
| Hangman II (16946)/ | 2026-01-04 14:11 | - | |
| Hangman III (13961)/ | 2026-01-04 14:11 | - | |
| Hangman IV (13962)/ | 2026-01-04 14:11 | - | |
| Hangman [Preview] (9066)/ | 2026-01-04 14:11 | - | |
| Hangman for Two (11767)/ | 2026-01-04 14:11 | - | |
| Hangmath (11239)/ | 2026-01-04 14:11 | - | |
| Hangmath (13811)/ | 2026-01-04 14:11 | - | |
| Hangmath (14821)/ | 2026-01-04 14:11 | - | |
| Hangmath (16769)/ | 2026-01-04 14:11 | - | |
| Hangperson (14859)/ | 2026-01-04 14:11 | - | |
| Hanoi (9484)/ | 2026-01-04 14:11 | - | |
| Hanoi (15878)/ | 2026-01-04 14:11 | - | |
| Hans Kloss (3402)/ | 2026-01-04 14:11 | - | |
| Hanse (3403)/ | 2026-01-04 14:11 | - | |
| Hanse (3404)/ | 2026-01-04 14:11 | - | |
| Hanseat (3405)/ | 2026-01-04 14:11 | - | |
| Happiest Days of Your Life, The (3406)/ | 2026-01-04 14:11 | - | |
| Happy Gardening (10144)/ | 2026-01-04 14:11 | - | |
| Happy Hacker (3407)/ | 2026-01-04 14:11 | - | |
| Happy Hurdler (12052)/ | 2026-01-04 14:11 | - | |
| Happy Tipping (17380)/ | 2026-01-04 14:11 | - | |
| Harak Iri (3409)/ | 2026-01-04 14:11 | - | |
| Harald Hardtooth - The Fight of the Clean Teeth (14319)/ | 2026-01-04 14:11 | - | |
| Harald Hartand - Kampen om de rene Taender (3410)/ | 2026-01-04 14:11 | - | |
| Haras (16270)/ | 2026-01-04 14:11 | - | |
| Harboro (3411)/ | 2026-01-04 14:11 | - | |
| Harbour Attack (3412)/ | 2026-01-04 14:11 | - | |
| Harcon - Herr des Lichts (3413)/ | 2026-01-04 14:11 | - | |
| Hard'n'Heavy (3414)/ | 2026-01-04 14:11 | - | |
| HardBall! (3418)/ | 2026-01-04 14:11 | - | |
| HardBall! II (3419)/ | 2026-01-04 14:11 | - | |
| Hard Drivin' (3415)/ | 2026-01-04 14:11 | - | |
| Hard Hat Mack (3416)/ | 2026-01-04 14:11 | - | |
| Hard Work (3417)/ | 2026-01-04 14:11 | - | |
| Hardfire [Preview] (3420)/ | 2026-01-04 14:11 | - | |
| Hardhat Climber (3421)/ | 2026-01-04 14:11 | - | |
| Hardporn Adventure #1 (3422)/ | 2026-01-04 14:11 | - | |
| Harem (16293)/ | 2026-01-04 14:11 | - | |
| Hareraiser (15511)/ | 2026-01-04 14:11 | - | |
| Harrier 7 (11181)/ | 2026-01-04 14:11 | - | |
| Harrier Attack (3423)/ | 2026-01-04 14:11 | - | |
| Harrier Attack (16284)/ | 2026-01-04 14:11 | - | |
| Harrier Combat Simulator (3424)/ | 2026-01-04 14:11 | - | |
| Harry - At New Zealand (11769)/ | 2026-01-04 14:11 | - | |
| Harry der Fensterputzer (10661)/ | 2026-01-04 14:11 | - | |
| Harte Dollars (3425)/ | 2026-01-04 14:11 | - | |
| Hartedief (17021)/ | 2026-01-04 14:11 | - | |
| Hartenjagen (3426)/ | 2026-01-04 14:11 | - | |
| Hartfaser-Adventure, Das (17395)/ | 2026-01-04 14:11 | - | |
| Harvey Headbanger (3427)/ | 2026-01-04 14:11 | - | |
| Harvey Smith Showjumper (3428)/ | 2026-01-04 14:11 | - | |
| Hase und Wolf (17396)/ | 2026-01-04 14:11 | - | |
| Hassle Castle (3429)/ | 2026-01-04 14:11 | - | |
| Hat Trick (3430)/ | 2026-01-04 14:11 | - | |
| Hatchet Honeymoon (3431)/ | 2026-01-04 14:11 | - | |
| Haunted Castle (9837)/ | 2026-01-04 14:11 | - | |
| Haunted Castle (11770)/ | 2026-01-04 14:11 | - | |
| Haunted Castle, The (9722)/ | 2026-01-04 14:11 | - | |
| Haunted Hill (3433)/ | 2026-01-04 14:11 | - | |
| Haunted House (3434)/ | 2026-01-04 14:11 | - | |
| Haunted House (10287)/ | 2026-01-04 14:11 | - | |
| Haunted House (10288)/ | 2026-01-04 14:11 | - | |
| Haunted House (11771)/ | 2026-01-04 14:11 | - | |
| Haunted House, The (10286)/ | 2026-01-04 14:11 | - | |
| Haunted Inn (14611)/ | 2026-01-04 14:11 | - | |
| Haunted Manor (11772)/ | 2026-01-04 14:11 | - | |
| Haunted Mansion (9474)/ | 2026-01-04 14:11 | - | |
| Haus des Magiers, Das (3435)/ | 2026-01-04 14:11 | - | |
| Have a Nice Day! (11773)/ | 2026-01-04 14:11 | - | |
| Havoc (3436)/ | 2026-01-04 14:11 | - | |
| Havoc (3437)/ | 2026-01-04 14:11 | - | |
| Hawaii (3438)/ | 2026-01-04 14:11 | - | |
| Hawk (3439)/ | 2026-01-04 14:11 | - | |
| Hawk Dash 01 (9985)/ | 2026-01-04 14:11 | - | |
| Hawk Dash 03 (9986)/ | 2026-01-04 14:11 | - | |
| Hawk Mission (3440)/ | 2026-01-04 14:11 | - | |
| Hawk Mission II (3441)/ | 2026-01-04 14:11 | - | |
| Hawk Mission III (3442)/ | 2026-01-04 14:11 | - | |
| Hawk Storm (3445)/ | 2026-01-04 14:11 | - | |
| Hawk [Preview] (3444)/ | 2026-01-04 14:11 | - | |
| Hawkeye (3446)/ | 2026-01-04 14:11 | - | |
| Hawkmen of Dindrin (3447)/ | 2026-01-04 14:11 | - | |
| Hawks (11774)/ | 2026-01-04 14:11 | - | |
| Hazar (3448)/ | 2026-01-04 14:11 | - | |
| Hazard (15891)/ | 2026-01-04 14:11 | - | |
| Haze Maze (11775)/ | 2026-01-04 14:11 | - | |
| He-Man - Master of the Universe (11425)/ | 2026-01-04 14:11 | - | |
| He-Man and the Masters of the Universe (3450)/ | 2026-01-04 14:11 | - | |
| He Man Junior (3449)/ | 2026-01-04 14:11 | - | |
| Head-On (9700)/ | 2026-01-04 14:11 | - | |
| Head-On (9740)/ | 2026-01-04 14:11 | - | |
| Head-to-Head Karate (3457)/ | 2026-01-04 14:11 | - | |
| Head Coach (3451)/ | 2026-01-04 14:11 | - | |
| Head On (3452)/ | 2026-01-04 14:11 | - | |
| Head On (3453)/ | 2026-01-04 14:11 | - | |
| Head On (13727)/ | 2026-01-04 14:11 | - | |
| Head Over Heels (3454)/ | 2026-01-04 14:11 | - | |
| Head Start (3455)/ | 2026-01-04 14:11 | - | |
| Headache (3458)/ | 2026-01-04 14:11 | - | |
| Headache (11776)/ | 2026-01-04 14:11 | - | |
| Headon (13186)/ | 2026-01-04 14:11 | - | |
| Head the Ball (3456)/ | 2026-01-04 14:11 | - | |
| Head to Head (9725)/ | 2026-01-04 14:11 | - | |
| Heart Attack! (3459)/ | 2026-01-04 14:11 | - | |
| Heart and Maze (17851)/ | 2026-01-04 14:11 | - | |
| Heartland (3462)/ | 2026-01-04 14:11 | - | |
| Heart of Africa (3460)/ | 2026-01-04 14:11 | - | |
| Heart of Africa (3461)/ | 2026-01-04 14:11 | - | |
| Hearts (14055)/ | 2026-01-04 14:11 | - | |
| Heat Seeker (3463)/ | 2026-01-04 14:11 | - | |
| Heat Wave (3464)/ | 2026-01-04 14:11 | - | |
| Heathrow Air Traffic Control (11092)/ | 2026-01-04 14:11 | - | |
| Heatseeker (3465)/ | 2026-01-04 14:11 | - | |
| Heavenbound (3466)/ | 2026-01-04 14:11 | - | |
| Heavenly Bodies (15402)/ | 2026-01-04 14:11 | - | |
| Heavy Metal - Modern Land Combat Vol. I (3467)/ | 2026-01-04 14:11 | - | |
| Heavy Metal Deluxe! (14890)/ | 2026-01-04 14:11 | - | |
| Heavy Metal Solid (11022)/ | 2026-01-04 14:11 | - | |
| Hebbes (11777)/ | 2026-01-04 14:11 | - | |
| Hebel [Preview] (3469)/ | 2026-01-04 14:11 | - | |
| Heckenschuetzen (16947)/ | 2026-01-04 14:11 | - | |
| Heebie Jeebie (3470)/ | 2026-01-04 14:11 | - | |
| Heidelberg - Das Adventure (13556)/ | 2026-01-04 14:11 | - | |
| Heilige Ruestung des Antiriad, Die (10983)/ | 2026-01-04 14:11 | - | |
| Heisse Luft (3471)/ | 2026-01-04 14:11 | - | |
| Heist, The (3472)/ | 2026-01-04 14:11 | - | |
| Hektic (3473)/ | 2026-01-04 14:11 | - | |
| Hektic II (3474)/ | 2026-01-04 14:11 | - | |
| Hektik (3475)/ | 2026-01-04 14:11 | - | |
| Helden (3476)/ | 2026-01-04 14:11 | - | |
| Heli-Bombers! (16617)/ | 2026-01-04 14:11 | - | |
| Heli-Command (3479)/ | 2026-01-04 14:11 | - | |
| Heli-Command (10621)/ | 2026-01-04 14:11 | - | |
| Heli-Fight (11780)/ | 2026-01-04 14:11 | - | |
| Heli-Jump (14367)/ | 2026-01-04 14:11 | - | |
| Heli Drop (3477)/ | 2026-01-04 14:11 | - | |
| Heli Rescue (3478)/ | 2026-01-04 14:11 | - | |
| Heli Squad (9153)/ | 2026-01-04 14:11 | - | |
| Helicopter (11779)/ | 2026-01-04 14:11 | - | |
| Helicopter (16196)/ | 2026-01-04 14:11 | - | |
| Helicopter (16206)/ | 2026-01-04 14:11 | - | |
| Helicopter Fighter (15106)/ | 2026-01-04 14:11 | - | |
| Helicopter Mission (3480)/ | 2026-01-04 14:11 | - | |
| Helicopter Mission, The (10093)/ | 2026-01-04 14:11 | - | |
| Helicopter Mission I (15336)/ | 2026-01-04 14:11 | - | |
| Helikopter Jagd (3481)/ | 2026-01-04 14:11 | - | |
| Helimission (14161)/ | 2026-01-04 14:11 | - | |
| Hell (3482)/ | 2026-01-04 14:11 | - | |
| Hell Cat Ace (3483)/ | 2026-01-04 14:11 | - | |
| Hell Fighter (3484)/ | 2026-01-04 14:11 | - | |
| Hell Rider (9655)/ | 2026-01-04 14:11 | - | |
| Hell Zone (13078)/ | 2026-01-04 14:11 | - | |
| Hell Zone II (3486)/ | 2026-01-04 14:11 | - | |
| Helldiver [Preview] (3487)/ | 2026-01-04 14:11 | - | |
| Hellfire (3488)/ | 2026-01-04 14:11 | - | |
| Hell for Leather (3485)/ | 2026-01-04 14:11 | - | |
| Hellgate (3489)/ | 2026-01-04 14:11 | - | |
| Hellhole (3490)/ | 2026-01-04 14:11 | - | |
| Hellion, The (17510)/ | 2026-01-04 14:11 | - | |
| Hellowoon (3491)/ | 2026-01-04 14:11 | - | |
| Hellraid (11781)/ | 2026-01-04 14:11 | - | |
| Hellraiser on the Highway (15445)/ | 2026-01-04 14:11 | - | |
| Hells Bells (3492)/ | 2026-01-04 14:11 | - | |
| Hells End (10401)/ | 2026-01-04 14:11 | - | |
| Helm, The (3493)/ | 2026-01-04 14:11 | - | |
| Helsingfors (14478)/ | 2026-01-04 14:11 | - | |
| Helter Skelter (3494)/ | 2026-01-04 14:11 | - | |
| Heng Gubben (3495)/ | 2026-01-04 14:11 | - | |
| Henker (10990)/ | 2026-01-04 14:11 | - | |
| Henker (17335)/ | 2026-01-04 14:11 | - | |
| Henrietta's Book of Spells (3496)/ | 2026-01-04 14:11 | - | |
| Henry's House (3498)/ | 2026-01-04 14:11 | - | |
| Henry [Preview] (3497)/ | 2026-01-04 14:11 | - | |
| Herakles (14001)/ | 2026-01-04 14:11 | - | |
| Herakles (15345)/ | 2026-01-04 14:11 | - | |
| Herakles - The Early Trials (10085)/ | 2026-01-04 14:11 | - | |
| Herbert's Dummy Run (3500)/ | 2026-01-04 14:11 | - | |
| Herbert's Dummy Run (16280)/ | 2026-01-04 14:11 | - | |
| Herbert on the Slopes (3499)/ | 2026-01-04 14:11 | - | |
| Herby (3501)/ | 2026-01-04 14:11 | - | |
| Herby Thriller (3503)/ | 2026-01-04 14:11 | - | |
| Herby in Action (3502)/ | 2026-01-04 14:11 | - | |
| Hercules (3505)/ | 2026-01-04 14:11 | - | |
| Hercules - Slayer of the Damned (3506)/ | 2026-01-04 14:11 | - | |
| Hermetic (3507)/ | 2026-01-04 14:11 | - | |
| Hermit, The (11314)/ | 2026-01-04 14:11 | - | |
| Hero 2020 (3509)/ | 2026-01-04 14:11 | - | |
| Hero Quest (3511)/ | 2026-01-04 14:11 | - | |
| Hero Quest II - Return of the Witchlord (3512)/ | 2026-01-04 14:11 | - | |
| Herobotix (3513)/ | 2026-01-04 14:11 | - | |
| Heroe, El (14160)/ | 2026-01-04 14:11 | - | |
| Heroes of Karn, The (3514)/ | 2026-01-04 14:11 | - | |
| Heroes of the Lance (3515)/ | 2026-01-04 14:11 | - | |
| Heroic Quest I (3516)/ | 2026-01-04 14:11 | - | |
| Hero of the Golden Talisman (3510)/ | 2026-01-04 14:11 | - | |
| Heros - Drei gegen das Inferno (11661)/ | 2026-01-04 14:11 | - | |
| Herpes or Bust (10400)/ | 2026-01-04 14:11 | - | |
| Herzogtum Kronland (16401)/ | 2026-01-04 14:11 | - | |
| Heuristic Chomp (14303)/ | 2026-01-04 14:11 | - | |
| Hex (14386)/ | 2026-01-04 14:11 | - | |
| Hex Number Puzzle (14387)/ | 2026-01-04 14:11 | - | |
| Hex Number Puzzle (15378)/ | 2026-01-04 14:11 | - | |
| Hex War (9779)/ | 2026-01-04 14:11 | - | |
| Hexagon (3518)/ | 2026-01-04 14:11 | - | |
| Hexagon Puzzle (3519)/ | 2026-01-04 14:11 | - | |
| Hexapawn (11006)/ | 2026-01-04 14:11 | - | |
| Hexapuzzler (13249)/ | 2026-01-04 14:11 | - | |
| Hexenkueche (3520)/ | 2026-01-04 14:11 | - | |
| Hexenkueche II - Der Kuerbis schlaegt zurueck (3521)/ | 2026-01-04 14:11 | - | |
| Hexensabbat (3522)/ | 2026-01-04 14:11 | - | |
| Hexpawn (13963)/ | 2026-01-04 14:11 | - | |
| Hexpert (3523)/ | 2026-01-04 14:11 | - | |
| Hexperty (15813)/ | 2026-01-04 14:11 | - | |
| Hey Diddle Diddle (14688)/ | 2026-01-04 14:11 | - | |
| Hi-Lo (11785)/ | 2026-01-04 14:11 | - | |
| Hi-Lo (14543)/ | 2026-01-04 14:11 | - | |
| Hi-Q (3526)/ | 2026-01-04 14:11 | - | |
| Hi-Q (14941)/ | 2026-01-04 14:11 | - | |
| Hi-Q-Quiz (3527)/ | 2026-01-04 14:11 | - | |
| Hi Bouncer (3524)/ | 2026-01-04 14:11 | - | |
| Hi Ska Do (3525)/ | 2026-01-04 14:11 | - | |
| Hickory, Dickory, Dock (11309)/ | 2026-01-04 14:11 | - | |
| Hickory Dickory Dock (11374)/ | 2026-01-04 14:11 | - | |
| Hidden Cavern (9728)/ | 2026-01-04 14:11 | - | |
| Hidden Doors [Preview] (3528)/ | 2026-01-04 14:11 | - | |
| Hidden Picture (15392)/ | 2026-01-04 14:11 | - | |
| Hidden Treasure of Inca, The (3741)/ | 2026-01-04 14:11 | - | |
| Hide & Seek (15267)/ | 2026-01-04 14:11 | - | |
| Hide'n Sequence (14679)/ | 2026-01-04 14:11 | - | |
| Hide n Seek (14308)/ | 2026-01-04 14:11 | - | |
| Hideous! (3530)/ | 2026-01-04 14:11 | - | |
| Hideous Bill & the Gi-Gants (3529)/ | 2026-01-04 14:11 | - | |
| Hidihood (3531)/ | 2026-01-04 14:11 | - | |
| High Flyer (3532)/ | 2026-01-04 14:11 | - | |
| High Flyer (9798)/ | 2026-01-04 14:11 | - | |
| High Frontier (3533)/ | 2026-01-04 14:11 | - | |
| High Gear (11782)/ | 2026-01-04 14:11 | - | |
| High Memory (3534)/ | 2026-01-04 14:11 | - | |
| High Noon (13682)/ | 2026-01-04 14:11 | - | |
| High Rise (3535)/ | 2026-01-04 14:11 | - | |
| High Rise (11421)/ | 2026-01-04 14:11 | - | |
| High Rise or Three Card Brag (3536)/ | 2026-01-04 14:11 | - | |
| High Risk (11783)/ | 2026-01-04 14:11 | - | |
| High Roller (3537)/ | 2026-01-04 14:11 | - | |
| High Rollers (3538)/ | 2026-01-04 14:11 | - | |
| High Rollers (9781)/ | 2026-01-04 14:11 | - | |
| High Rollers (13964)/ | 2026-01-04 14:11 | - | |
| High Seas (3539)/ | 2026-01-04 14:11 | - | |
| High Voltage! (3540)/ | 2026-01-04 14:11 | - | |
| High Way (14390)/ | 2026-01-04 14:11 | - | |
| Higher or Lower (11784)/ | 2026-01-04 14:11 | - | |
| Highland Games (3541)/ | 2026-01-04 14:11 | - | |
| Highlander (3542)/ | 2026-01-04 14:11 | - | |
| Highnoon (3543)/ | 2026-01-04 14:11 | - | |
| Highway (15042)/ | 2026-01-04 14:11 | - | |
| Highway Code (13587)/ | 2026-01-04 14:11 | - | |
| Highway Code (17728)/ | 2026-01-04 14:11 | - | |
| Highway Encounter (3544)/ | 2026-01-04 14:11 | - | |
| Highway of Death (11786)/ | 2026-01-04 14:11 | - | |
| Hike (13728)/ | 2026-01-04 14:11 | - | |
| Hilldash (10007)/ | 2026-01-04 14:11 | - | |
| Hillsfar (3545)/ | 2026-01-04 14:11 | - | |
| Himalayan Odyssey (3546)/ | 2026-01-04 14:11 | - | |
| Hindenburg (3547)/ | 2026-01-04 14:11 | - | |
| Hip Hop (12240)/ | 2026-01-04 14:11 | - | |
| Hires-Motocrash (10141)/ | 2026-01-04 14:11 | - | |
| Hirnris (3548)/ | 2026-01-04 14:11 | - | |
| Historic Mazes (13266)/ | 2026-01-04 14:11 | - | |
| History Challenge (13292)/ | 2026-01-04 14:11 | - | |
| History Challenge II (13379)/ | 2026-01-04 14:11 | - | |
| History Challenge III (12541)/ | 2026-01-04 14:11 | - | |
| History Flash (15487)/ | 2026-01-04 14:11 | - | |
| History Quiz (17732)/ | 2026-01-04 14:11 | - | |
| Historycross (17091)/ | 2026-01-04 14:11 | - | |
| Hit Ball (3549)/ | 2026-01-04 14:11 | - | |
| Hitch Hiker's Guide to the Galaxy, The (3551)/ | 2026-01-04 14:11 | - | |
| Hitchhiker's Guide to the Galaxy, The (3552)/ | 2026-01-04 14:11 | - | |
| Hitchhiker's Guide to the Galaxy, The (3553)/ | 2026-01-04 14:11 | - | |
| Hitler-Diktator (3555)/ | 2026-01-04 14:11 | - | |
| Hit the Ball (11787)/ | 2026-01-04 14:11 | - | |
| Hit the Brick (3550)/ | 2026-01-04 14:11 | - | |
| Hit the Bricks (11018)/ | 2026-01-04 14:11 | - | |
| Hive! (9320)/ | 2026-01-04 14:11 | - | |
| Hman (11788)/ | 2026-01-04 14:11 | - | |
| Ho! Ho! Ho! (15480)/ | 2026-01-04 14:11 | - | |
| Hoax (3556)/ | 2026-01-04 14:11 | - | |
| Hobbit, The (3557)/ | 2026-01-04 14:11 | - | |
| Hobbit, The (3558)/ | 2026-01-04 14:11 | - | |
| Hobgoblin (3559)/ | 2026-01-04 14:11 | - | |
| Hochhaus (13606)/ | 2026-01-04 14:11 | - | |
| Hockey (3560)/ | 2026-01-04 14:11 | - | |
| Hockey Mania (16441)/ | 2026-01-04 14:11 | - | |
| Hocus Focus (3561)/ | 2026-01-04 14:11 | - | |
| Hoehle (9899)/ | 2026-01-04 14:11 | - | |
| Hoehlengeheimnis (9255)/ | 2026-01-04 14:11 | - | |
| Hoger of Lager (9618)/ | 2026-01-04 14:11 | - | |
| Hole-In-One (3563)/ | 2026-01-04 14:11 | - | |
| Hole in One (3562)/ | 2026-01-04 14:11 | - | |
| Holf (3564)/ | 2026-01-04 14:11 | - | |
| Holiday Cops (3565)/ | 2026-01-04 14:11 | - | |
| Holiday Games (3566)/ | 2026-01-04 14:11 | - | |
| Hollanditis (3567)/ | 2026-01-04 14:11 | - | |
| Hollywood (16084)/ | 2026-01-04 14:11 | - | |
| Hollywood Hijinx (3568)/ | 2026-01-04 14:11 | - | |
| Hollywood Poker (3570)/ | 2026-01-04 14:11 | - | |
| Hollywood Poker Pro (3571)/ | 2026-01-04 14:11 | - | |
| Hollywood Squares (9890)/ | 2026-01-04 14:11 | - | |
| Hollywood or Bust (3569)/ | 2026-01-04 14:11 | - | |
| Holo (3572)/ | 2026-01-04 14:11 | - | |
| Holocaust (11792)/ | 2026-01-04 14:11 | - | |
| Holy Grail, The (10825)/ | 2026-01-04 14:11 | - | |
| Holy Roman Empire, The (9321)/ | 2026-01-04 14:11 | - | |
| Hombre (15328)/ | 2026-01-04 14:11 | - | |
| Home Hungaroring (3573)/ | 2026-01-04 14:11 | - | |
| Home Run Derby (11793)/ | 2026-01-04 14:11 | - | |
| Homonym Practice (10704)/ | 2026-01-04 14:11 | - | |
| Honeymooners, The (3574)/ | 2026-01-04 14:11 | - | |
| Hong Kong Phooey (3575)/ | 2026-01-04 14:11 | - | |
| Honigbaer (11133)/ | 2026-01-04 14:11 | - | |
| Honigbaer II and his Friends! (16222)/ | 2026-01-04 14:11 | - | |
| Hoodoo Voodoo (3576)/ | 2026-01-04 14:11 | - | |
| Hoofdsteden van Europa (9643)/ | 2026-01-04 14:11 | - | |
| Hook (3577)/ | 2026-01-04 14:11 | - | |
| Hook Dodger (3578)/ | 2026-01-04 14:11 | - | |
| Hook the X (3579)/ | 2026-01-04 14:11 | - | |
| Hooligandash (10005)/ | 2026-01-04 14:11 | - | |
| Hooligandash III (10006)/ | 2026-01-04 14:11 | - | |
| Hooper (3580)/ | 2026-01-04 14:11 | - | |
| Hoops (3581)/ | 2026-01-04 14:11 | - | |
| Hop Along Counting (14590)/ | 2026-01-04 14:11 | - | |
| Hop Around (10473)/ | 2026-01-04 14:11 | - | |
| Hope and Glory (3582)/ | 2026-01-04 14:11 | - | |
| Hopeless (3584)/ | 2026-01-04 14:11 | - | |
| Hopeloos (10838)/ | 2026-01-04 14:11 | - | |
| Hope to Hopp (11056)/ | 2026-01-04 14:11 | - | |
| Hope to Hopp II (3583)/ | 2026-01-04 14:11 | - | |
| Hopper (3586)/ | 2026-01-04 14:11 | - | |
| Hopper (12520)/ | 2026-01-04 14:11 | - | |
| Hopper Copper (3587)/ | 2026-01-04 14:11 | - | |
| Hoppin' Mad (3588)/ | 2026-01-04 14:11 | - | |
| Hopping Hoodlum, The (3589)/ | 2026-01-04 14:11 | - | |
| Hopp oder Top (3585)/ | 2026-01-04 14:11 | - | |
| Hopto (3590)/ | 2026-01-04 14:11 | - | |
| Horace Goes Skiing (3591)/ | 2026-01-04 14:11 | - | |
| Horny Wanker (16319)/ | 2026-01-04 14:11 | - | |
| Horror City (3593)/ | 2026-01-04 14:11 | - | |
| Horror Flip (11794)/ | 2026-01-04 14:11 | - | |
| Horror Hotel (17113)/ | 2026-01-04 14:11 | - | |
| Horse (12012)/ | 2026-01-04 14:11 | - | |
| Horse, The (13431)/ | 2026-01-04 14:11 | - | |
| Horse Games (14956)/ | 2026-01-04 14:11 | - | |
| Horse Race (16618)/ | 2026-01-04 14:11 | - | |
| Horse Race Game (3594)/ | 2026-01-04 14:11 | - | |
| Horse Racing (3595)/ | 2026-01-04 14:11 | - | |
| Horse Racing (13965)/ | 2026-01-04 14:11 | - | |
| Horse Racing (16948)/ | 2026-01-04 14:11 | - | |
| Horseguard (13531)/ | 2026-01-04 14:11 | - | |
| Horserace (10399)/ | 2026-01-04 14:11 | - | |
| Hospital Adventure (11795)/ | 2026-01-04 14:11 | - | |
| Hospital Adventure (16722)/ | 2026-01-04 14:11 | - | |
| Hostage! (3596)/ | 2026-01-04 14:11 | - | |
| Hostage (10861)/ | 2026-01-04 14:11 | - | |
| Hostages (3597)/ | 2026-01-04 14:11 | - | |
| Hot-Food (3604)/ | 2026-01-04 14:11 | - | |
| Hot Air Balloon (16357)/ | 2026-01-04 14:11 | - | |
| Hot Dog (17117)/ | 2026-01-04 14:11 | - | |
| Hot Ice Race (3598)/ | 2026-01-04 14:11 | - | |
| Hot Pop (3599)/ | 2026-01-04 14:11 | - | |
| Hot Rod (3600)/ | 2026-01-04 14:11 | - | |
| Hot Shot (3601)/ | 2026-01-04 14:11 | - | |
| Hot Shot (3612)/ | 2026-01-04 14:11 | - | |
| Hot Space Duel (15025)/ | 2026-01-04 14:11 | - | |
| Hot Wheels (3602)/ | 2026-01-04 14:11 | - | |
| Hot Wheels (3603)/ | 2026-01-04 14:11 | - | |
| Hotel (3605)/ | 2026-01-04 14:11 | - | |
| Hotel (3606)/ | 2026-01-04 14:11 | - | |
| Hotel Alien (3607)/ | 2026-01-04 14:11 | - | |
| Hotel Hell - Not a Nice Place to Die (3608)/ | 2026-01-04 14:11 | - | |
| Hotfoot (3610)/ | 2026-01-04 14:11 | - | |
| Hotfoot II - I'm Walking Again (3611)/ | 2026-01-04 14:11 | - | |
| Hotshot (16017)/ | 2026-01-04 14:11 | - | |
| Houdini Escape (11789)/ | 2026-01-04 14:11 | - | |
| Hounded (12926)/ | 2026-01-04 14:11 | - | |
| Hounded - The Greyhound Racing Simulation (3613)/ | 2026-01-04 14:11 | - | |
| House, The (3616)/ | 2026-01-04 14:11 | - | |
| House, The (3617)/ | 2026-01-04 14:11 | - | |
| House-Mess (3618)/ | 2026-01-04 14:11 | - | |
| House Case (15950)/ | 2026-01-04 14:11 | - | |
| House Jack Built, The (3614)/ | 2026-01-04 14:11 | - | |
| House of Seven Gables, The (9635)/ | 2026-01-04 14:11 | - | |
| House of Usher (3615)/ | 2026-01-04 14:11 | - | |
| Housepainter (12364)/ | 2026-01-04 14:11 | - | |
| Houston (3619)/ | 2026-01-04 14:11 | - | |
| Hover (3620)/ | 2026-01-04 14:11 | - | |
| Hover Bovver (3621)/ | 2026-01-04 14:11 | - | |
| Hover Raider (3622)/ | 2026-01-04 14:11 | - | |
| Hoverjet (3623)/ | 2026-01-04 14:11 | - | |
| How About a Nice Game of Chess! (1425)/ | 2026-01-04 14:11 | - | |
| Howard Johnson Football (11569)/ | 2026-01-04 14:11 | - | |
| Howard the Coder (13567)/ | 2026-01-04 14:11 | - | |
| Howard the Duck - Adventure on Volcano Island (3625)/ | 2026-01-04 14:11 | - | |
| How to be a Complete Bastard (3624)/ | 2026-01-04 14:11 | - | |
| Hubie the Cubie (16873)/ | 2026-01-04 14:11 | - | |
| Huddy (3626)/ | 2026-01-04 14:11 | - | |
| Hudson Hawk (3627)/ | 2026-01-04 14:11 | - | |
| Huehnerfarm (11126)/ | 2026-01-04 14:11 | - | |
| Huetchenspiel (16368)/ | 2026-01-04 14:11 | - | |
| Human Anatomy Series - Skeleton Bones Tutorial (17389)/ | 2026-01-04 14:11 | - | |
| Human Killing Machine (3628)/ | 2026-01-04 14:11 | - | |
| Human Race, The (3629)/ | 2026-01-04 14:11 | - | |
| Human Rat Race, The (3630)/ | 2026-01-04 14:11 | - | |
| Humanoid [Preview] (10625)/ | 2026-01-04 14:11 | - | |
| Humanoids (3631)/ | 2026-01-04 14:11 | - | |
| Humanoids II (3632)/ | 2026-01-04 14:11 | - | |
| Humblebug [Preview] (13992)/ | 2026-01-04 14:11 | - | |
| Hummdinger (3633)/ | 2026-01-04 14:11 | - | |
| Humphrey (3634)/ | 2026-01-04 14:11 | - | |
| Humpty Dumpty Meets Fuzzy Wuzzies (3635)/ | 2026-01-04 14:11 | - | |
| Humpty Dumpty Mystery (14092)/ | 2026-01-04 14:11 | - | |
| Humpty in the Garden (3636)/ | 2026-01-04 14:11 | - | |
| Hunchback (3637)/ | 2026-01-04 14:11 | - | |
| Hunchback - The Adventure (3638)/ | 2026-01-04 14:11 | - | |
| Hunchback II - Quasimodo's Revenge (3640)/ | 2026-01-04 14:11 | - | |
| Hunchback at the Olympics (3639)/ | 2026-01-04 14:11 | - | |
| Hunchy (3641)/ | 2026-01-04 14:11 | - | |
| Hungaroring (3642)/ | 2026-01-04 14:11 | - | |
| Hungary Rally (11087)/ | 2026-01-04 14:11 | - | |
| Hungry Horace (3643)/ | 2026-01-04 14:11 | - | |
| Hungry Worm (17604)/ | 2026-01-04 14:11 | - | |
| Hunkly (14375)/ | 2026-01-04 14:11 | - | |
| Hunter's Moon (3649)/ | 2026-01-04 14:11 | - | |
| Hunter (9563)/ | 2026-01-04 14:11 | - | |
| Hunter-Killer 64 (11791)/ | 2026-01-04 14:11 | - | |
| Hunter-Killer Atlantic (16567)/ | 2026-01-04 14:11 | - | |
| Hunter Joe (14028)/ | 2026-01-04 14:11 | - | |
| Hunter Patrol (3648)/ | 2026-01-04 14:11 | - | |
| Hunters (12032)/ | 2026-01-04 14:11 | - | |
| Hunt for Lost Divers (11125)/ | 2026-01-04 14:11 | - | |
| Hunt for Red October, The (3644)/ | 2026-01-04 14:11 | - | |
| Hunt for Red October, The (3645)/ | 2026-01-04 14:11 | - | |
| Huntman (16374)/ | 2026-01-04 14:11 | - | |
| Hunt the Bismarck (3646)/ | 2026-01-04 14:11 | - | |
| Hunt the Pie Thief (14829)/ | 2026-01-04 14:11 | - | |
| Hunt the Wumpus (10178)/ | 2026-01-04 14:11 | - | |
| Hunt the Wumpus II (8758)/ | 2026-01-04 14:11 | - | |
| Hurkle (10927)/ | 2026-01-04 14:11 | - | |
| Hurkle (13824)/ | 2026-01-04 14:11 | - | |
| Hurra (11254)/ | 2026-01-04 14:11 | - | |
| Hurricane (3650)/ | 2026-01-04 14:11 | - | |
| Hurting the Ground (9323)/ | 2026-01-04 14:11 | - | |
| Hustler (3651)/ | 2026-01-04 14:11 | - | |
| Huxley Pig (3652)/ | 2026-01-04 14:11 | - | |
| Hyber Blob (3660)/ | 2026-01-04 14:11 | - | |
| Hybrid (3653)/ | 2026-01-04 14:11 | - | |
| Hydra (3654)/ | 2026-01-04 14:11 | - | |
| Hydrax (3655)/ | 2026-01-04 14:11 | - | |
| Hypa-Ball (3656)/ | 2026-01-04 14:11 | - | |
| Hypa-Ball (10915)/ | 2026-01-04 14:11 | - | |
| Hypadrop (16949)/ | 2026-01-04 14:11 | - | |
| Hyper-Hen (3667)/ | 2026-01-04 14:11 | - | |
| Hyper Active (3657)/ | 2026-01-04 14:11 | - | |
| Hyper Aggressive (3658)/ | 2026-01-04 14:11 | - | |
| Hyper Ball (10388)/ | 2026-01-04 14:11 | - | |
| Hyper Biker (13235)/ | 2026-01-04 14:11 | - | |
| Hyper Blast (3659)/ | 2026-01-04 14:11 | - | |
| Hyper Cars (3661)/ | 2026-01-04 14:11 | - | |
| Hyper Cars (16570)/ | 2026-01-04 14:11 | - | |
| Hyper Circuit (3662)/ | 2026-01-04 14:11 | - | |
| Hyper Drive (16003)/ | 2026-01-04 14:11 | - | |
| Hyper Galactic Warrior (3663)/ | 2026-01-04 14:11 | - | |
| Hyper Olympic (10626)/ | 2026-01-04 14:11 | - | |
| Hyper Orm Jr. (17648)/ | 2026-01-04 14:11 | - | |
| Hyper Plasma Race 2309 (17011)/ | 2026-01-04 14:11 | - | |
| Hyper Reaction (9324)/ | 2026-01-04 14:11 | - | |
| Hyper Snake (3664)/ | 2026-01-04 14:11 | - | |
| Hyper Space Warrior (3665)/ | 2026-01-04 14:11 | - | |
| Hyper Sports (3666)/ | 2026-01-04 14:11 | - | |
| HyperZap (16950)/ | 2026-01-04 14:11 | - | |
| Hyperbowl (3668)/ | 2026-01-04 14:11 | - | |
| Hyperforce (3669)/ | 2026-01-04 14:11 | - | |
| Hyperion II (3670)/ | 2026-01-04 14:11 | - | |
| Hyperrace (3671)/ | 2026-01-04 14:11 | - | |
| Hyperspeed (3672)/ | 2026-01-04 14:11 | - | |
| Hyperthrust (3673)/ | 2026-01-04 14:11 | - | |
| Hypertrek (16299)/ | 2026-01-04 14:11 | - | |
| Hyphen (13971)/ | 2026-01-04 14:11 | - | |
| Hypra-Chess (10139)/ | 2026-01-04 14:11 | - | |
| Hysteria (3674)/ | 2026-01-04 14:11 | - | |
| Hysteria (3675)/ | 2026-01-04 14:11 | - | |
| Hysterix (10776)/ | 2026-01-04 14:11 | - | |
|
|---|