![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | A, V or M (13626)/ | 2026-01-04 14:11 | - | |
| A-Boulder 64 (11428)/ | 2026-01-04 14:11 | - | |
| A-Maze-Ing (10891)/ | 2026-01-04 14:11 | - | |
| A-Team, The (9357)/ | 2026-01-04 14:11 | - | |
| A-Z - Spiel (13958)/ | 2026-01-04 14:11 | - | |
| A-Z Quiz (11618)/ | 2026-01-04 14:11 | - | |
| ABC (85)/ | 2026-01-04 14:11 | - | |
| ABC - Alphabet Beasts & Co. (10087)/ | 2026-01-04 14:11 | - | |
| AC-DC Pinball (92)/ | 2026-01-04 14:11 | - | |
| ACE - Air Combat Emulator (94)/ | 2026-01-04 14:11 | - | |
| ACE - Air Combat Emulator (13956)/ | 2026-01-04 14:11 | - | |
| ADIDAS Championship Football (132)/ | 2026-01-04 14:11 | - | |
| ADIDAS Championship Tie Break (7929)/ | 2026-01-04 14:11 | - | |
| AECEA (15529)/ | 2026-01-04 14:11 | - | |
| AFK - Aim, Fire, Kill (9698)/ | 2026-01-04 14:11 | - | |
| AFL Boulder Dash (159)/ | 2026-01-04 14:11 | - | |
| AFO (14340)/ | 2026-01-04 14:11 | - | |
| AGCK - Arcade Game Construction Kit (363)/ | 2026-01-04 14:11 | - | |
| AGE - The Adventure Grafik Editor (12334)/ | 2026-01-04 14:11 | - | |
| AMC - Advance of the Mega Camels (15329)/ | 2026-01-04 14:11 | - | |
| AMC - Astro Marine Corps (279)/ | 2026-01-04 14:11 | - | |
| AMC - Attack of the Mutant Camels (280)/ | 2026-01-04 14:11 | - | |
| AMC - Attack of the Mutant Camels (281)/ | 2026-01-04 14:11 | - | |
| AMP - Attack of the Mutant Pricks (294)/ | 2026-01-04 14:11 | - | |
| AMT - Attack of the Mutant TFF's (2946)/ | 2026-01-04 14:11 | - | |
| AOK-Spiel (15517)/ | 2026-01-04 14:11 | - | |
| AP (17079)/ | 2026-01-04 14:11 | - | |
| APB - All Points Bulletin (332)/ | 2026-01-04 14:11 | - | |
| APEX [Preview] (335)/ | 2026-01-04 14:11 | - | |
| ARAC (351)/ | 2026-01-04 14:11 | - | |
| ATA (471)/ | 2026-01-04 14:11 | - | |
| ATC - Air Traffic Controller (188)/ | 2026-01-04 14:11 | - | |
| ATC - Air Traffic Controller (12720)/ | 2026-01-04 14:11 | - | |
| ATF - Advanced Tactical Fighter (474)/ | 2026-01-04 14:11 | - | |
| ATG - All Terrain Gardener (11020)/ | 2026-01-04 14:11 | - | |
| ATV - All Terrain Vehicle Simulator (492)/ | 2026-01-04 14:11 | - | |
| Aaargh! (81)/ | 2026-01-04 14:11 | - | |
| Aanval (14520)/ | 2026-01-04 14:11 | - | |
| Aardvark (82)/ | 2026-01-04 14:11 | - | |
| Aardvark Attack (10696)/ | 2026-01-04 14:11 | - | |
| Aargh! Condor (83)/ | 2026-01-04 14:11 | - | |
| Aargh Krakout (14402)/ | 2026-01-04 14:11 | - | |
| Abandon (84)/ | 2026-01-04 14:11 | - | |
| Abducted (17161)/ | 2026-01-04 14:11 | - | |
| Abeceda (86)/ | 2026-01-04 14:11 | - | |
| Abenteuergame (15233)/ | 2026-01-04 14:11 | - | |
| Abfahrer (16747)/ | 2026-01-04 14:11 | - | |
| Abhor (9179)/ | 2026-01-04 14:11 | - | |
| Abnormal Faction (87)/ | 2026-01-04 14:11 | - | |
| Abrakadabra (88)/ | 2026-01-04 14:11 | - | |
| Abrakadabra [Preview] (9872)/ | 2026-01-04 14:11 | - | |
| Abrasco Golf (89)/ | 2026-01-04 14:11 | - | |
| Abstract [Preview] (90)/ | 2026-01-04 14:11 | - | |
| Abwehr (13735)/ | 2026-01-04 14:11 | - | |
| Abyss (91)/ | 2026-01-04 14:11 | - | |
| Acceleration (10750)/ | 2026-01-04 14:11 | - | |
| Acchiappa Pacchi (15003)/ | 2026-01-04 14:11 | - | |
| Accolade Comics - Steve Keene, Private Spy (93)/ | 2026-01-04 14:11 | - | |
| Accordion (16578)/ | 2026-01-04 14:11 | - | |
| Accumulator (15317)/ | 2026-01-04 14:11 | - | |
| Ace (95)/ | 2026-01-04 14:11 | - | |
| Ace 2088 (96)/ | 2026-01-04 14:11 | - | |
| Ace Harrier (97)/ | 2026-01-04 14:11 | - | |
| Ace II (98)/ | 2026-01-04 14:11 | - | |
| Ace II [Preview] (99)/ | 2026-01-04 14:11 | - | |
| Ace Pro (102)/ | 2026-01-04 14:11 | - | |
| Ace of Aces (100)/ | 2026-01-04 14:11 | - | |
| Ace of Hearts [Preview] (101)/ | 2026-01-04 14:11 | - | |
| Aces High (15905)/ | 2026-01-04 14:11 | - | |
| Aces Up (103)/ | 2026-01-04 14:11 | - | |
| Aces Up (13415)/ | 2026-01-04 14:11 | - | |
| Acey-Deucy (10966)/ | 2026-01-04 14:11 | - | |
| Achie (104)/ | 2026-01-04 14:11 | - | |
| Acia (105)/ | 2026-01-04 14:11 | - | |
| Acid (9928)/ | 2026-01-04 14:11 | - | |
| Acid Ball [Preview] (8941)/ | 2026-01-04 14:11 | - | |
| Acid House [Preview] (106)/ | 2026-01-04 14:11 | - | |
| Acid Runner (107)/ | 2026-01-04 14:11 | - | |
| Acidman (108)/ | 2026-01-04 14:11 | - | |
| Acigol (10671)/ | 2026-01-04 14:11 | - | |
| Acinna (109)/ | 2026-01-04 14:11 | - | |
| Acquire (13503)/ | 2026-01-04 14:11 | - | |
| AcroJet (110)/ | 2026-01-04 14:11 | - | |
| Acrobat (11303)/ | 2026-01-04 14:11 | - | |
| Action! Hockey (10752)/ | 2026-01-04 14:11 | - | |
| Action-Ball (118)/ | 2026-01-04 14:11 | - | |
| Action Biker '99 (112)/ | 2026-01-04 14:11 | - | |
| Action Biker (111)/ | 2026-01-04 14:11 | - | |
| Action Fighter (113)/ | 2026-01-04 14:11 | - | |
| Action Force (114)/ | 2026-01-04 14:11 | - | |
| Action Replay Worm (116)/ | 2026-01-04 14:11 | - | |
| Action Service (117)/ | 2026-01-04 14:11 | - | |
| Actionauts (119)/ | 2026-01-04 14:11 | - | |
| Actionauts II (120)/ | 2026-01-04 14:11 | - | |
| Action on Protection (115)/ | 2026-01-04 14:11 | - | |
| Ad Infinitum (121)/ | 2026-01-04 14:11 | - | |
| Ad Infinitum (122)/ | 2026-01-04 14:11 | - | |
| Add & Sub (14233)/ | 2026-01-04 14:11 | - | |
| Add Fast (15208)/ | 2026-01-04 14:11 | - | |
| Addams Family, The (123)/ | 2026-01-04 14:11 | - | |
| Addgar (124)/ | 2026-01-04 14:11 | - | |
| Addicta Ball (125)/ | 2026-01-04 14:11 | - | |
| Addicted (10753)/ | 2026-01-04 14:11 | - | |
| Addit (14446)/ | 2026-01-04 14:11 | - | |
| Addition & Subtraction (14836)/ | 2026-01-04 14:11 | - | |
| Addition Drill (127)/ | 2026-01-04 14:11 | - | |
| Addition Drill (14665)/ | 2026-01-04 14:11 | - | |
| Addition Magician (128)/ | 2026-01-04 14:11 | - | |
| Addition Master (13239)/ | 2026-01-04 14:11 | - | |
| Addition Race (129)/ | 2026-01-04 14:11 | - | |
| Addition and Subtraction (126)/ | 2026-01-04 14:11 | - | |
| Addition and Subtraction (17722)/ | 2026-01-04 14:11 | - | |
| Adds and Subs (130)/ | 2026-01-04 14:11 | - | |
| Adermen (131)/ | 2026-01-04 14:11 | - | |
| Admiral Graf Spee (10684)/ | 2026-01-04 14:11 | - | |
| Admiral James Cook (13569)/ | 2026-01-04 14:11 | - | |
| Adonis (9822)/ | 2026-01-04 14:11 | - | |
| Adonis (13863)/ | 2026-01-04 14:11 | - | |
| Adrenalin (133)/ | 2026-01-04 14:11 | - | |
| Adroit [Preview] (134)/ | 2026-01-04 14:11 | - | |
| Adult Poker (11914)/ | 2026-01-04 14:11 | - | |
| Adults (11750)/ | 2026-01-04 14:11 | - | |
| Advanced Action Movie Simulator (14971)/ | 2026-01-04 14:11 | - | |
| Advanced Coloured (10754)/ | 2026-01-04 14:11 | - | |
| Advanced Dungeons & Dragons [Preview] (135)/ | 2026-01-04 14:11 | - | |
| Advanced Lotto Simulator (9920)/ | 2026-01-04 14:11 | - | |
| Advanced Pinball Simulator (136)/ | 2026-01-04 14:11 | - | |
| Advanced Swimming Simulator (17060)/ | 2026-01-04 14:11 | - | |
| Advance to Boardwalk (9305)/ | 2026-01-04 14:11 | - | |
| Adventure (9652)/ | 2026-01-04 14:11 | - | |
| Adventure (9906)/ | 2026-01-04 14:11 | - | |
| Adventure (11031)/ | 2026-01-04 14:11 | - | |
| Adventure - The Ultimate Text Adventure (137)/ | 2026-01-04 14:11 | - | |
| Adventure 1 - Cavern of Riches (138)/ | 2026-01-04 14:11 | - | |
| Adventure 2 - The Great Pyramid (139)/ | 2026-01-04 14:11 | - | |
| Adventure 3 - Haunted Mansion (141)/ | 2026-01-04 14:11 | - | |
| Adventure 64 - Colossal Cave Adventure (10755)/ | 2026-01-04 14:11 | - | |
| Adventure 2000 - Die Jagd nach der Rakete (140)/ | 2026-01-04 14:11 | - | |
| Adventure 2000 - Die Jagd nach der Rakete (9212)/ | 2026-01-04 14:11 | - | |
| Adventure Castle (142)/ | 2026-01-04 14:11 | - | |
| Adventure Castle (14003)/ | 2026-01-04 14:11 | - | |
| Adventure Construction Set (143)/ | 2026-01-04 14:11 | - | |
| Adventure Creator (144)/ | 2026-01-04 14:11 | - | |
| Adventure Interpretor (147)/ | 2026-01-04 14:11 | - | |
| Adventure Island (10069)/ | 2026-01-04 14:11 | - | |
| Adventure Land (12274)/ | 2026-01-04 14:11 | - | |
| Adventure Master (14843)/ | 2026-01-04 14:11 | - | |
| Adventure Quest (149)/ | 2026-01-04 14:11 | - | |
| Adventure Shell (150)/ | 2026-01-04 14:11 | - | |
| Adventure Thru (17585)/ | 2026-01-04 14:11 | - | |
| Adventure Thru II (17586)/ | 2026-01-04 14:11 | - | |
| Adventure Without a Name (10756)/ | 2026-01-04 14:11 | - | |
| AdventureWriter (15332)/ | 2026-01-04 14:11 | - | |
| Adventure Writing System (14004)/ | 2026-01-04 14:11 | - | |
| Adventure der Saeufer (11261)/ | 2026-01-04 14:11 | - | |
| Adventure in Atlantis (145)/ | 2026-01-04 14:11 | - | |
| Adventure in Time and Space (146)/ | 2026-01-04 14:11 | - | |
| Adventureland (151)/ | 2026-01-04 14:11 | - | |
| Adventureland (152)/ | 2026-01-04 14:11 | - | |
| Adventure of a Lifetime (15777)/ | 2026-01-04 14:11 | - | |
| Adventure of a Mug (10076)/ | 2026-01-04 14:11 | - | |
| Adventure of the Year (148)/ | 2026-01-04 14:11 | - | |
| Adventure on the Planet of Zeeble (10757)/ | 2026-01-04 14:11 | - | |
| Adventurer, The (9758)/ | 2026-01-04 14:11 | - | |
| Adventures of Barsak the Dwarf, The (153)/ | 2026-01-04 14:11 | - | |
| Adventures of Bond... Basildon Bond, The (638)/ | 2026-01-04 14:11 | - | |
| Adventures of Buckaroo Banzai, The (154)/ | 2026-01-04 14:11 | - | |
| Adventures of Buckaroo Banzai, The (10726)/ | 2026-01-04 14:11 | - | |
| Adventures of Jim Slim in Dragonland, The [Preview] (155)/ | 2026-01-04 14:11 | - | |
| Adventures of the Little Ghostkid, The (156)/ | 2026-01-04 14:11 | - | |
| Adventureworld (15126)/ | 2026-01-04 14:11 | - | |
| Aeaenimuistipeli (10585)/ | 2026-01-04 14:11 | - | |
| Aegean Voyage (157)/ | 2026-01-04 14:11 | - | |
| Aerobics (158)/ | 2026-01-04 14:11 | - | |
| Aerohawk (12690)/ | 2026-01-04 14:11 | - | |
| Aerosol (15493)/ | 2026-01-04 14:11 | - | |
| Affaire Vera Cruz, L' (4220)/ | 2026-01-04 14:11 | - | |
| Affairs of State (10758)/ | 2026-01-04 14:11 | - | |
| Affen-Jagd (14091)/ | 2026-01-04 14:11 | - | |
| Africa (10759)/ | 2026-01-04 14:11 | - | |
| Africa Gardens (160)/ | 2026-01-04 14:11 | - | |
| Africa Nera (161)/ | 2026-01-04 14:11 | - | |
| African Adventure - In Search of Dr. Livingston (163)/ | 2026-01-04 14:11 | - | |
| African Escape (10760)/ | 2026-01-04 14:11 | - | |
| African Escape (10761)/ | 2026-01-04 14:11 | - | |
| African Safari (164)/ | 2026-01-04 14:11 | - | |
| Afrikan Taehti (162)/ | 2026-01-04 14:11 | - | |
| AfterLife (167)/ | 2026-01-04 14:11 | - | |
| AfterLife v2.0 (12598)/ | 2026-01-04 14:11 | - | |
| Afterburner (166)/ | 2026-01-04 14:11 | - | |
| Afterburner (9762)/ | 2026-01-04 14:11 | - | |
| Aftermath (168)/ | 2026-01-04 14:11 | - | |
| Aftermath (169)/ | 2026-01-04 14:11 | - | |
| Aftermath of the Asimovian Disaster, The (11913)/ | 2026-01-04 14:11 | - | |
| Aftermath of the Asimovian Disaster, The (16454)/ | 2026-01-04 14:11 | - | |
| After the Party (10119)/ | 2026-01-04 14:11 | - | |
| After the War (165)/ | 2026-01-04 14:11 | - | |
| After the War (16238)/ | 2026-01-04 14:11 | - | |
| Afterworld, The (170)/ | 2026-01-04 14:11 | - | |
| Agent Blotto (9331)/ | 2026-01-04 14:11 | - | |
| Agent Hawk (14361)/ | 2026-01-04 14:11 | - | |
| Agent Orange (174)/ | 2026-01-04 14:11 | - | |
| Agent UOP (175)/ | 2026-01-04 14:11 | - | |
| Agent USA (176)/ | 2026-01-04 14:11 | - | |
| Agent USA II (177)/ | 2026-01-04 14:11 | - | |
| Agent X II - The Mad Prof's Back (178)/ | 2026-01-04 14:11 | - | |
| Age of Adventure - Ali Baba and the Forty Thieves (171)/ | 2026-01-04 14:11 | - | |
| Age of Adventure - The Return of Heracles (172)/ | 2026-01-04 14:11 | - | |
| Aggression (16145)/ | 2026-01-04 14:11 | - | |
| Aghamix (179)/ | 2026-01-04 14:11 | - | |
| Agnes (180)/ | 2026-01-04 14:11 | - | |
| Agricola (181)/ | 2026-01-04 14:11 | - | |
| Aguilas, Las (14122)/ | 2026-01-04 14:11 | - | |
| Ah Diddums (182)/ | 2026-01-04 14:11 | - | |
| Ai confini della realt (15940)/ | 2026-01-04 14:11 | - | |
| Aidon - The Apocalypse (183)/ | 2026-01-04 14:11 | - | |
| Aids Fighters (9715)/ | 2026-01-04 14:11 | - | |
| Aigina's Prophecy (184)/ | 2026-01-04 14:11 | - | |
| Air-Command (10433)/ | 2026-01-04 14:11 | - | |
| Air-Raid [Preview] (14006)/ | 2026-01-04 14:11 | - | |
| Air Assault (10264)/ | 2026-01-04 14:11 | - | |
| Air Attack (15064)/ | 2026-01-04 14:11 | - | |
| Air Ball (12291)/ | 2026-01-04 14:11 | - | |
| Air Defender (13552)/ | 2026-01-04 14:11 | - | |
| Air Port Game (13550)/ | 2026-01-04 14:11 | - | |
| Air Rallye (185)/ | 2026-01-04 14:11 | - | |
| Air Rescue (9727)/ | 2026-01-04 14:11 | - | |
| Air Rescue I (186)/ | 2026-01-04 14:11 | - | |
| Air Support (187)/ | 2026-01-04 14:11 | - | |
| Air Traffic Controller (15482)/ | 2026-01-04 14:11 | - | |
| Airbase Controller (10680)/ | 2026-01-04 14:11 | - | |
| Airbattle - Shoot Off Planes (15769)/ | 2026-01-04 14:11 | - | |
| Airborne Ranger (189)/ | 2026-01-04 14:11 | - | |
| Airborne Ranger (190)/ | 2026-01-04 14:11 | - | |
| Airborne Rangers (191)/ | 2026-01-04 14:11 | - | |
| Airbus-A300 Simulator (15127)/ | 2026-01-04 14:11 | - | |
| Aircommando (192)/ | 2026-01-04 14:11 | - | |
| Aircop 2000 (193)/ | 2026-01-04 14:11 | - | |
| Aircraft Lander (9629)/ | 2026-01-04 14:11 | - | |
| Airfight (15128)/ | 2026-01-04 14:11 | - | |
| Airline (14324)/ | 2026-01-04 14:11 | - | |
| Airline (16083)/ | 2026-01-04 14:11 | - | |
| Airport '94 (12539)/ | 2026-01-04 14:11 | - | |
| Airraid (9858)/ | 2026-01-04 14:11 | - | |
| Airship, The (195)/ | 2026-01-04 14:11 | - | |
| Airship II, The (196)/ | 2026-01-04 14:11 | - | |
| Airwalk Basketball (10762)/ | 2026-01-04 14:11 | - | |
| Airwar (10763)/ | 2026-01-04 14:11 | - | |
| Airwolf (197)/ | 2026-01-04 14:11 | - | |
| Airwolf (15082)/ | 2026-01-04 14:11 | - | |
| Airwolf II (199)/ | 2026-01-04 14:11 | - | |
| Airwolf II [Preview] (198)/ | 2026-01-04 14:11 | - | |
| Ake III - Ake Gets Mediaeval (9912)/ | 2026-01-04 14:11 | - | |
| Ake II [Preview] (200)/ | 2026-01-04 14:11 | - | |
| Ake [Preview] (201)/ | 2026-01-04 14:11 | - | |
| Aknakeresoe (202)/ | 2026-01-04 14:11 | - | |
| Akropolis (203)/ | 2026-01-04 14:11 | - | |
| Aksjemarked (14229)/ | 2026-01-04 14:11 | - | |
| Aktenzeichen X-14 (4915)/ | 2026-01-04 14:11 | - | |
| Aktienspiel, Das (11626)/ | 2026-01-04 14:11 | - | |
| Aktiv (9423)/ | 2026-01-04 14:11 | - | |
| Al Barakah (16330)/ | 2026-01-04 14:11 | - | |
| Al Capone (204)/ | 2026-01-04 14:11 | - | |
| Ala (206)/ | 2026-01-04 14:11 | - | |
| Ala, La (14084)/ | 2026-01-04 14:11 | - | |
| Alberts Drom [Exciting Dreams] (13864)/ | 2026-01-04 14:11 | - | |
| Alcatraz (15129)/ | 2026-01-04 14:11 | - | |
| Alcazar - The Forgotten Fortress (207)/ | 2026-01-04 14:11 | - | |
| Alchemist's Apprentice (11157)/ | 2026-01-04 14:11 | - | |
| Alchemy 1K (17065)/ | 2026-01-04 14:11 | - | |
| Alcon (208)/ | 2026-01-04 14:11 | - | |
| Aldebaran (9631)/ | 2026-01-04 14:11 | - | |
| Alderan (209)/ | 2026-01-04 14:11 | - | |
| Alert [Preview] (210)/ | 2026-01-04 14:11 | - | |
| Alesian Plains (16659)/ | 2026-01-04 14:11 | - | |
| Alf (212)/ | 2026-01-04 14:11 | - | |
| Alf - The First Adventure (211)/ | 2026-01-04 14:11 | - | |
| Alfabet (9170)/ | 2026-01-04 14:11 | - | |
| Alfabetic Highway (15539)/ | 2026-01-04 14:11 | - | |
| Alfabug (10690)/ | 2026-01-04 14:11 | - | |
| Alf in the Color Caves (213)/ | 2026-01-04 14:11 | - | |
| Alfredo's Breakout (16329)/ | 2026-01-04 14:11 | - | |
| Alfredo's Parking (214)/ | 2026-01-04 14:11 | - | |
| Alge-Blaster! (10088)/ | 2026-01-04 14:11 | - | |
| Algebra Dragons, The (10998)/ | 2026-01-04 14:11 | - | |
| Algernon (15130)/ | 2026-01-04 14:11 | - | |
| Alhambra (16645)/ | 2026-01-04 14:11 | - | |
| Ali Baba (215)/ | 2026-01-04 14:11 | - | |
| Aliants - The Desperate Battle for Earth (216)/ | 2026-01-04 14:11 | - | |
| Alice (217)/ | 2026-01-04 14:11 | - | |
| Alice in Videoland (218)/ | 2026-01-04 14:11 | - | |
| Alice in Wonderland (219)/ | 2026-01-04 14:11 | - | |
| Alien (220)/ | 2026-01-04 14:11 | - | |
| Alien (221)/ | 2026-01-04 14:11 | - | |
| Alien (222)/ | 2026-01-04 14:11 | - | |
| Alien (9264)/ | 2026-01-04 14:11 | - | |
| Alien (13654)/ | 2026-01-04 14:11 | - | |
| Alien (17447)/ | 2026-01-04 14:11 | - | |
| Alien 3 (223)/ | 2026-01-04 14:11 | - | |
| Alien Armada (224)/ | 2026-01-04 14:11 | - | |
| Alien Attack (225)/ | 2026-01-04 14:11 | - | |
| Alien Attack (226)/ | 2026-01-04 14:11 | - | |
| Alien Attack (9428)/ | 2026-01-04 14:11 | - | |
| Alien Attack (9648)/ | 2026-01-04 14:11 | - | |
| Alien Attack (10586)/ | 2026-01-04 14:11 | - | |
| Alien Attack II (14244)/ | 2026-01-04 14:11 | - | |
| Alien Attack III - The Final Attack (10681)/ | 2026-01-04 14:11 | - | |
| Alien Attacker (10587)/ | 2026-01-04 14:11 | - | |
| Alien Bash (9088)/ | 2026-01-04 14:11 | - | |
| Alien Blast (13777)/ | 2026-01-04 14:11 | - | |
| Alien Blast II (16292)/ | 2026-01-04 14:11 | - | |
| Alien Blaster (227)/ | 2026-01-04 14:11 | - | |
| Alien Blaster (17490)/ | 2026-01-04 14:11 | - | |
| Alien Brood (228)/ | 2026-01-04 14:11 | - | |
| Alien City Blitz (229)/ | 2026-01-04 14:11 | - | |
| Alien Commando - The Ship (9306)/ | 2026-01-04 14:11 | - | |
| Alien Commando II - Planet X (5747)/ | 2026-01-04 14:11 | - | |
| Alien Commando III - Planet Ice (12412)/ | 2026-01-04 14:11 | - | |
| Alien Destroyer (230)/ | 2026-01-04 14:11 | - | |
| Alien Fighter (9524)/ | 2026-01-04 14:11 | - | |
| Alien Infiltration (12716)/ | 2026-01-04 14:11 | - | |
| Alien Infiltration II (16553)/ | 2026-01-04 14:11 | - | |
| Alien Infiltration III (12634)/ | 2026-01-04 14:11 | - | |
| Alien Infiltration IV (12635)/ | 2026-01-04 14:11 | - | |
| Alien Invader (231)/ | 2026-01-04 14:11 | - | |
| Alien Invaders (16483)/ | 2026-01-04 14:11 | - | |
| Alien Invasion (15982)/ | 2026-01-04 14:11 | - | |
| Alien Invasion (17530)/ | 2026-01-04 14:11 | - | |
| Alien Kill (9362)/ | 2026-01-04 14:11 | - | |
| Alien Kill II - The Final Encounter (232)/ | 2026-01-04 14:11 | - | |
| Alien Killers (233)/ | 2026-01-04 14:11 | - | |
| Alien Panic (234)/ | 2026-01-04 14:11 | - | |
| Alien Panic (16528)/ | 2026-01-04 14:11 | - | |
| Alien Rescue (235)/ | 2026-01-04 14:11 | - | |
| Alien Rescue (15131)/ | 2026-01-04 14:11 | - | |
| Alien Science Quiz (13382)/ | 2026-01-04 14:11 | - | |
| Alien Sidestep (14585)/ | 2026-01-04 14:11 | - | |
| Alien Smash (236)/ | 2026-01-04 14:11 | - | |
| Alien Smash (9048)/ | 2026-01-04 14:11 | - | |
| Alien Snipers (17329)/ | 2026-01-04 14:11 | - | |
| Alien Sounds (237)/ | 2026-01-04 14:11 | - | |
| Alien Storm (238)/ | 2026-01-04 14:11 | - | |
| Alien Storm (12710)/ | 2026-01-04 14:11 | - | |
| Alien Syndrome (239)/ | 2026-01-04 14:11 | - | |
| Alien Task Force (10432)/ | 2026-01-04 14:11 | - | |
| Alien Task Force II (10437)/ | 2026-01-04 14:11 | - | |
| Alien Terrordome (12053)/ | 2026-01-04 14:11 | - | |
| Alien War [Preview] (240)/ | 2026-01-04 14:11 | - | |
| Alien Zoo (12604)/ | 2026-01-04 14:11 | - | |
| Alienator! (241)/ | 2026-01-04 14:11 | - | |
| Alienator (10470)/ | 2026-01-04 14:11 | - | |
| Alienator 93 (14341)/ | 2026-01-04 14:11 | - | |
| Aliens (243)/ | 2026-01-04 14:11 | - | |
| Aliens (14123)/ | 2026-01-04 14:11 | - | |
| Aliens - The Computer Game (242)/ | 2026-01-04 14:11 | - | |
| Aliens from Subterrania (244)/ | 2026-01-04 14:11 | - | |
| Alienworld (245)/ | 2026-01-04 14:11 | - | |
| Alioids (10764)/ | 2026-01-04 14:11 | - | |
| Alioth (246)/ | 2026-01-04 14:11 | - | |
| Alioth (10471)/ | 2026-01-04 14:11 | - | |
| Alioth (14230)/ | 2026-01-04 14:11 | - | |
| Alison's Maths (247)/ | 2026-01-04 14:11 | - | |
| All-American Basketball (251)/ | 2026-01-04 14:11 | - | |
| All Risks (248)/ | 2026-01-04 14:11 | - | |
| All Smiles (249)/ | 2026-01-04 14:11 | - | |
| All Smiles (12678)/ | 2026-01-04 14:11 | - | |
| All Smiles Maze Maker (13216)/ | 2026-01-04 14:11 | - | |
| All Stars (250)/ | 2026-01-04 14:11 | - | |
| Allan Border's Cricket (252)/ | 2026-01-04 14:11 | - | |
| Alla ricerca del Buddha di Bodhnath (16139)/ | 2026-01-04 14:11 | - | |
| Alle Neune (9472)/ | 2026-01-04 14:11 | - | |
| Alle Neune (15132)/ | 2026-01-04 14:11 | - | |
| Alley Cat (253)/ | 2026-01-04 14:11 | - | |
| Alley Oops (254)/ | 2026-01-04 14:11 | - | |
| Alley Wars (12221)/ | 2026-01-04 14:11 | - | |
| Alleykat (255)/ | 2026-01-04 14:11 | - | |
| Alleyoop (10765)/ | 2026-01-04 14:11 | - | |
| Allgemeinbildungsprogramm, Das (14826)/ | 2026-01-04 14:11 | - | |
| Allgemeinwissen (9243)/ | 2026-01-04 14:11 | - | |
| Alliance (256)/ | 2026-01-04 14:11 | - | |
| Allien Pacmann (15133)/ | 2026-01-04 14:11 | - | |
| Alligator! (14558)/ | 2026-01-04 14:11 | - | |
| Alligator Moeras (257)/ | 2026-01-04 14:11 | - | |
| All or Nothing (16800)/ | 2026-01-04 14:11 | - | |
| Alloyrun (258)/ | 2026-01-04 14:11 | - | |
| Almazz (259)/ | 2026-01-04 14:11 | - | |
| Alone (16332)/ | 2026-01-04 14:11 | - | |
| Alpha-Shoot (10701)/ | 2026-01-04 14:11 | - | |
| Alpha Aliens (16847)/ | 2026-01-04 14:11 | - | |
| Alpha Anxiety (260)/ | 2026-01-04 14:11 | - | |
| Alpha Build (11010)/ | 2026-01-04 14:11 | - | |
| Alpha Command (261)/ | 2026-01-04 14:11 | - | |
| Alpha Omega Run (262)/ | 2026-01-04 14:11 | - | |
| Alpha Test, The (13325)/ | 2026-01-04 14:11 | - | |
| Alpha Type (14231)/ | 2026-01-04 14:11 | - | |
| Alpha Warriors (10663)/ | 2026-01-04 14:11 | - | |
| Alphabet Cadet (12120)/ | 2026-01-04 14:11 | - | |
| Alphabet Circus (12352)/ | 2026-01-04 14:11 | - | |
| Alphabet Shuffle, The (11032)/ | 2026-01-04 14:11 | - | |
| Alphabet Soup (11219)/ | 2026-01-04 14:11 | - | |
| Alphabet Trainer (12672)/ | 2026-01-04 14:11 | - | |
| Alphabet Zoo (11284)/ | 2026-01-04 14:11 | - | |
| Alphabetica (15838)/ | 2026-01-04 14:11 | - | |
| Alphabetizing Practice (14234)/ | 2026-01-04 14:11 | - | |
| Alphabetter (14269)/ | 2026-01-04 14:11 | - | |
| Alphabopper (16860)/ | 2026-01-04 14:11 | - | |
| Alphafighter (9880)/ | 2026-01-04 14:11 | - | |
| Alphametix (13324)/ | 2026-01-04 14:11 | - | |
| Alphoid (263)/ | 2026-01-04 14:11 | - | |
| Alpine Encounter, The (10120)/ | 2026-01-04 14:11 | - | |
| Alpine Escape (14312)/ | 2026-01-04 14:11 | - | |
| Alpine Tram Ride (11078)/ | 2026-01-04 14:11 | - | |
| Alpiner, The (10265)/ | 2026-01-04 14:11 | - | |
| Altair 4 (264)/ | 2026-01-04 14:11 | - | |
| Altarius [Preview] (12987)/ | 2026-01-04 14:11 | - | |
| Alter Ego - Female Version (266)/ | 2026-01-04 14:11 | - | |
| Alter Ego - Male Version (265)/ | 2026-01-04 14:11 | - | |
| Altered Beast (267)/ | 2026-01-04 14:11 | - | |
| Altered States [Preview] (268)/ | 2026-01-04 14:11 | - | |
| Alternate Reality - The City (269)/ | 2026-01-04 14:11 | - | |
| Alternate Reality - The Dungeon (270)/ | 2026-01-04 14:11 | - | |
| Alternative World Games (271)/ | 2026-01-04 14:11 | - | |
| Al the Fish [Preview] (205)/ | 2026-01-04 14:11 | - | |
| Alzan (10909)/ | 2026-01-04 14:11 | - | |
| Amadeus Revenge (272)/ | 2026-01-04 14:11 | - | |
| Amaurote (273)/ | 2026-01-04 14:11 | - | |
| Amazer (11838)/ | 2026-01-04 14:11 | - | |
| Amazin' (17782)/ | 2026-01-04 14:11 | - | |
| Amazing (15068)/ | 2026-01-04 14:11 | - | |
| Amazing Adventure (10804)/ | 2026-01-04 14:11 | - | |
| Amazing Facts (17587)/ | 2026-01-04 14:11 | - | |
| Amazing Facts II (17588)/ | 2026-01-04 14:11 | - | |
| Amazing Spider-Man, The (274)/ | 2026-01-04 14:11 | - | |
| Amazon (275)/ | 2026-01-04 14:11 | - | |
| Amazon (276)/ | 2026-01-04 14:11 | - | |
| Amazon Warrior (277)/ | 2026-01-04 14:11 | - | |
| Ambassador (10963)/ | 2026-01-04 14:11 | - | |
| Ambush! (10469)/ | 2026-01-04 14:11 | - | |
| Ambush (278)/ | 2026-01-04 14:11 | - | |
| Ambush (10468)/ | 2026-01-04 14:11 | - | |
| Amebas [Preview] (16850)/ | 2026-01-04 14:11 | - | |
| Ameisenbaer (17471)/ | 2026-01-04 14:11 | - | |
| America's Cup (12179)/ | 2026-01-04 14:11 | - | |
| America's Cup, The (12423)/ | 2026-01-04 14:11 | - | |
| America - Coast to Coast (282)/ | 2026-01-04 14:11 | - | |
| American 3D Pool (283)/ | 2026-01-04 14:11 | - | |
| American Basketball Heroes (284)/ | 2026-01-04 14:11 | - | |
| American Challenge, The - A Sailing Simulation (15352)/ | 2026-01-04 14:11 | - | |
| American Dateline (12691)/ | 2026-01-04 14:11 | - | |
| American Express (286)/ | 2026-01-04 14:11 | - | |
| American Football (287)/ | 2026-01-04 14:11 | - | |
| American Tag Team Wrestling (288)/ | 2026-01-04 14:11 | - | |
| Ameriganos (16745)/ | 2026-01-04 14:11 | - | |
| Ameriganos ein Adventure Teil II (16746)/ | 2026-01-04 14:11 | - | |
| Amerika's Agent (14263)/ | 2026-01-04 14:11 | - | |
| Amnesia (289)/ | 2026-01-04 14:11 | - | |
| Amnesia (290)/ | 2026-01-04 14:11 | - | |
| Amoba (13887)/ | 2026-01-04 14:11 | - | |
| Amoeba (291)/ | 2026-01-04 14:11 | - | |
| Amoeba (292)/ | 2026-01-04 14:11 | - | |
| Amoeba (15134)/ | 2026-01-04 14:11 | - | |
| Amok - The Game [Preview] (13959)/ | 2026-01-04 14:11 | - | |
| Amorphous (293)/ | 2026-01-04 14:11 | - | |
| Amulet, The (7953)/ | 2026-01-04 14:11 | - | |
| Anagram Sam (15904)/ | 2026-01-04 14:11 | - | |
| Anarchy (295)/ | 2026-01-04 14:11 | - | |
| Anarchy Prof. 1 (10964)/ | 2026-01-04 14:11 | - | |
| Anasthasia [Preview] (296)/ | 2026-01-04 14:11 | - | |
| Ancient History (297)/ | 2026-01-04 14:11 | - | |
| Ancient Tale, The (10965)/ | 2026-01-04 14:11 | - | |
| Ancipital (298)/ | 2026-01-04 14:11 | - | |
| Anders Limpar's Proffs Fotboll (299)/ | 2026-01-04 14:11 | - | |
| Android Attack (9148)/ | 2026-01-04 14:11 | - | |
| Android Control (301)/ | 2026-01-04 14:11 | - | |
| Android II (300)/ | 2026-01-04 14:11 | - | |
| Android Nim (11220)/ | 2026-01-04 14:11 | - | |
| Android Nim (13865)/ | 2026-01-04 14:11 | - | |
| Andromeda Conquest (302)/ | 2026-01-04 14:11 | - | |
| Andy Capp - The Game (303)/ | 2026-01-04 14:11 | - | |
| Angel of the Hell (304)/ | 2026-01-04 14:11 | - | |
| Angels' Boulder Dash (13866)/ | 2026-01-04 14:11 | - | |
| Anger (16828)/ | 2026-01-04 14:11 | - | |
| Angle (305)/ | 2026-01-04 14:11 | - | |
| Angle (15307)/ | 2026-01-04 14:11 | - | |
| Angle Ball (306)/ | 2026-01-04 14:11 | - | |
| Angle Iron (12135)/ | 2026-01-04 14:11 | - | |
| Angler 64 (12247)/ | 2026-01-04 14:11 | - | |
| Anglers, The (307)/ | 2026-01-04 14:11 | - | |
| Angriff auf den Archipel (13736)/ | 2026-01-04 14:11 | - | |
| Angriff der Klingonen (308)/ | 2026-01-04 14:11 | - | |
| Angry Ninja (10731)/ | 2026-01-04 14:11 | - | |
| Animal, Mineral or Vegetable (14235)/ | 2026-01-04 14:11 | - | |
| Animal Fare (13302)/ | 2026-01-04 14:11 | - | |
| Animal Hotel (13309)/ | 2026-01-04 14:11 | - | |
| Animal Magic - Save the Baby (10720)/ | 2026-01-04 14:11 | - | |
| Animal Match (309)/ | 2026-01-04 14:11 | - | |
| Animals! (14742)/ | 2026-01-04 14:11 | - | |
| Animals (310)/ | 2026-01-04 14:11 | - | |
| Animals (14304)/ | 2026-01-04 14:11 | - | |
| Animated Strip Poker (311)/ | 2026-01-04 14:11 | - | |
| Ankh (312)/ | 2026-01-04 14:11 | - | |
| Anna's Gram (13260)/ | 2026-01-04 14:11 | - | |
| Annaconda (313)/ | 2026-01-04 14:11 | - | |
| Annalen der Roemer (314)/ | 2026-01-04 14:11 | - | |
| Annals of Rome (315)/ | 2026-01-04 14:11 | - | |
| Annihilator (316)/ | 2026-01-04 14:11 | - | |
| Annihilator II (317)/ | 2026-01-04 14:11 | - | |
| Anonimus (318)/ | 2026-01-04 14:11 | - | |
| Anoria II (5416)/ | 2026-01-04 14:11 | - | |
| Another Bloody Adventure (11221)/ | 2026-01-04 14:11 | - | |
| Another Game (11586)/ | 2026-01-04 14:11 | - | |
| Another Sex Adventure (14338)/ | 2026-01-04 14:11 | - | |
| Another World (319)/ | 2026-01-04 14:11 | - | |
| Anstoss (320)/ | 2026-01-04 14:11 | - | |
| Ant Attack (321)/ | 2026-01-04 14:11 | - | |
| Anter Planter (322)/ | 2026-01-04 14:11 | - | |
| Anti (323)/ | 2026-01-04 14:11 | - | |
| Anti-Sub (12047)/ | 2026-01-04 14:11 | - | |
| AntiISDA Warrior (17034)/ | 2026-01-04 14:11 | - | |
| Anti Tuerkentest (9218)/ | 2026-01-04 14:11 | - | |
| Anticihilator (13867)/ | 2026-01-04 14:11 | - | |
| Antics (324)/ | 2026-01-04 14:11 | - | |
| Antics (15919)/ | 2026-01-04 14:11 | - | |
| Antifriction (325)/ | 2026-01-04 14:11 | - | |
| Antigravenreuth Game, The (15136)/ | 2026-01-04 14:11 | - | |
| Antihype (326)/ | 2026-01-04 14:11 | - | |
| Antimonopoly (9416)/ | 2026-01-04 14:11 | - | |
| Antiriad (16253)/ | 2026-01-04 14:11 | - | |
| Antonyms (14743)/ | 2026-01-04 14:11 | - | |
| Antonyms and Synonyms (11222)/ | 2026-01-04 14:11 | - | |
| Antrock (328)/ | 2026-01-04 14:11 | - | |
| Ants at War (16827)/ | 2026-01-04 14:11 | - | |
| A or An (14232)/ | 2026-01-04 14:11 | - | |
| Apache (10466)/ | 2026-01-04 14:11 | - | |
| Apache Helli (329)/ | 2026-01-04 14:11 | - | |
| Apache Raid (330)/ | 2026-01-04 14:11 | - | |
| Apache Strike (331)/ | 2026-01-04 14:11 | - | |
| Apartment of Mystery (16870)/ | 2026-01-04 14:11 | - | |
| Ape-Craze (334)/ | 2026-01-04 14:11 | - | |
| Ape Craze (333)/ | 2026-01-04 14:11 | - | |
| Ape Craze (9881)/ | 2026-01-04 14:11 | - | |
| Apocalypse Now (336)/ | 2026-01-04 14:11 | - | |
| Apocalypse Now (15626)/ | 2026-01-04 14:11 | - | |
| Apollo 14 [Preview] (337)/ | 2026-01-04 14:11 | - | |
| Apollo 18 - Mission to the Moon (338)/ | 2026-01-04 14:11 | - | |
| Apoxoly (339)/ | 2026-01-04 14:11 | - | |
| Appareil a Jetons (11223)/ | 2026-01-04 14:11 | - | |
| Apple Cider Spider (340)/ | 2026-01-04 14:11 | - | |
| Apple Fall (15021)/ | 2026-01-04 14:11 | - | |
| Apple Frenzy (341)/ | 2026-01-04 14:11 | - | |
| Apple Hunt (342)/ | 2026-01-04 14:11 | - | |
| Apple Pie (15497)/ | 2026-01-04 14:11 | - | |
| Apple Time (16918)/ | 2026-01-04 14:11 | - | |
| Apple Willy (343)/ | 2026-01-04 14:11 | - | |
| Apprentice (10122)/ | 2026-01-04 14:11 | - | |
| Apydia (11602)/ | 2026-01-04 14:11 | - | |
| Aqua (344)/ | 2026-01-04 14:11 | - | |
| Aqua Racer (345)/ | 2026-01-04 14:11 | - | |
| Aqua Racer (9342)/ | 2026-01-04 14:11 | - | |
| Aquablasta (10682)/ | 2026-01-04 14:11 | - | |
| Aquanaut (346)/ | 2026-01-04 14:11 | - | |
| Aquanaut (347)/ | 2026-01-04 14:11 | - | |
| Aquantor (348)/ | 2026-01-04 14:11 | - | |
| Aquaplane (349)/ | 2026-01-04 14:11 | - | |
| Arabian Treasurehunt (350)/ | 2026-01-04 14:11 | - | |
| Arachne (352)/ | 2026-01-04 14:11 | - | |
| Arachnia 64 (13212)/ | 2026-01-04 14:11 | - | |
| Arachnophobia (353)/ | 2026-01-04 14:11 | - | |
| Araknifoe (354)/ | 2026-01-04 14:11 | - | |
| Arbitrator [Preview] (10610)/ | 2026-01-04 14:11 | - | |
| Arc Angel [Preview] (355)/ | 2026-01-04 14:11 | - | |
| Arc Doors (356)/ | 2026-01-04 14:11 | - | |
| Arcade Attack 64 (358)/ | 2026-01-04 14:11 | - | |
| Arcade Baseball (359)/ | 2026-01-04 14:11 | - | |
| Arcade Classic (360)/ | 2026-01-04 14:11 | - | |
| Arcade Classics (361)/ | 2026-01-04 14:11 | - | |
| Arcade Flight Simulator (362)/ | 2026-01-04 14:11 | - | |
| Arcade Fruit Machine - Cash and Grab (1282)/ | 2026-01-04 14:11 | - | |
| Arcade Pilot (364)/ | 2026-01-04 14:11 | - | |
| Arcade Trivia Quiz (365)/ | 2026-01-04 14:11 | - | |
| Arcade Volleyball (366)/ | 2026-01-04 14:11 | - | |
| Arcademic Skillbuilder - Alien Addition (367)/ | 2026-01-04 14:11 | - | |
| Arcademic Skillbuilder - Alligator Mix (12183)/ | 2026-01-04 14:11 | - | |
| Arcademic Skillbuilder - Demolition Division (2103)/ | 2026-01-04 14:11 | - | |
| Arcademic Skillbuilder - Dragon Mix (368)/ | 2026-01-04 14:11 | - | |
| Arcademic Skillbuilder - Minus Mission (11939)/ | 2026-01-04 14:11 | - | |
| Arcademic Skillbuilder - Word Master (13038)/ | 2026-01-04 14:11 | - | |
| Arcadesearch (14744)/ | 2026-01-04 14:11 | - | |
| Arcadia (369)/ | 2026-01-04 14:11 | - | |
| Arcadia 64 (370)/ | 2026-01-04 14:11 | - | |
| Arcadian [Preview] (371)/ | 2026-01-04 14:11 | - | |
| Arcana (372)/ | 2026-01-04 14:11 | - | |
| Archdale Golf Club (373)/ | 2026-01-04 14:11 | - | |
| Archeologist Duel (374)/ | 2026-01-04 14:11 | - | |
| Archers, The (375)/ | 2026-01-04 14:11 | - | |
| Archetype (376)/ | 2026-01-04 14:11 | - | |
| Archipelago (377)/ | 2026-01-04 14:11 | - | |
| Archon (378)/ | 2026-01-04 14:11 | - | |
| Archon (379)/ | 2026-01-04 14:11 | - | |
| Archon II - Adept (380)/ | 2026-01-04 14:11 | - | |
| Archon III - Exciter (381)/ | 2026-01-04 14:11 | - | |
| Arciere (13613)/ | 2026-01-04 14:11 | - | |
| Arc of Yesod, The (357)/ | 2026-01-04 14:11 | - | |
| Arctic Fox (382)/ | 2026-01-04 14:11 | - | |
| Arctic Shipwreck (384)/ | 2026-01-04 14:11 | - | |
| Arctic Wastes! (10683)/ | 2026-01-04 14:11 | - | |
| Ardant (16356)/ | 2026-01-04 14:11 | - | |
| Ardok the Barbarian (385)/ | 2026-01-04 14:11 | - | |
| Ardy the Aardvark (386)/ | 2026-01-04 14:11 | - | |
| Area 13 (387)/ | 2026-01-04 14:11 | - | |
| Aree (15412)/ | 2026-01-04 14:11 | - | |
| Arena (389)/ | 2026-01-04 14:11 | - | |
| Arena (390)/ | 2026-01-04 14:11 | - | |
| Arena (391)/ | 2026-01-04 14:11 | - | |
| Arena (11657)/ | 2026-01-04 14:11 | - | |
| Arena 3000 (388)/ | 2026-01-04 14:11 | - | |
| Arena Football (392)/ | 2026-01-04 14:11 | - | |
| Arena Football (13591)/ | 2026-01-04 14:11 | - | |
| Arex (10066)/ | 2026-01-04 14:11 | - | |
| Argon (393)/ | 2026-01-04 14:11 | - | |
| Argon Factor, The (394)/ | 2026-01-04 14:11 | - | |
| Argos Expedition, The (395)/ | 2026-01-04 14:11 | - | |
| Arhena! The Amazon (396)/ | 2026-01-04 14:11 | - | |
| Arithme-Sketch (12007)/ | 2026-01-04 14:11 | - | |
| Arizona - The Boy in the Bubble (13557)/ | 2026-01-04 14:11 | - | |
| Ark Pandora (397)/ | 2026-01-04 14:11 | - | |
| Arkanoid (398)/ | 2026-01-04 14:11 | - | |
| Arkanoid - Revenge of Doh (399)/ | 2026-01-04 14:11 | - | |
| Arkanoid - Revenge of Doh Editor (402)/ | 2026-01-04 14:11 | - | |
| Arkanoid 003 (400)/ | 2026-01-04 14:11 | - | |
| Arkanoid Demo-Game (401)/ | 2026-01-04 14:11 | - | |
| Arkanoid II (9767)/ | 2026-01-04 14:11 | - | |
| Arkanoid III (403)/ | 2026-01-04 14:11 | - | |
| Arkanoid IV (404)/ | 2026-01-04 14:11 | - | |
| Arkanoid V (9500)/ | 2026-01-04 14:11 | - | |
| Ark of Exodus, The (10123)/ | 2026-01-04 14:11 | - | |
| Arktyczne Polowanie (14381)/ | 2026-01-04 14:11 | - | |
| Arktyczne Polowanie [Arctic Hunt] (383)/ | 2026-01-04 14:11 | - | |
| Armada (405)/ | 2026-01-04 14:11 | - | |
| Armada [Preview] (406)/ | 2026-01-04 14:11 | - | |
| Armageddon (407)/ | 2026-01-04 14:11 | - | |
| Armageddon (408)/ | 2026-01-04 14:11 | - | |
| Armageddon 2000 (13760)/ | 2026-01-04 14:11 | - | |
| Armageddon Files, The (409)/ | 2026-01-04 14:11 | - | |
| Armageddon Man, The (410)/ | 2026-01-04 14:11 | - | |
| Armageddon [Preview] (16161)/ | 2026-01-04 14:11 | - | |
| Armalyte (411)/ | 2026-01-04 14:11 | - | |
| Armalyte - Competition Edition (12835)/ | 2026-01-04 14:11 | - | |
| Armalyte II [Preview] (12834)/ | 2026-01-04 14:11 | - | |
| Armbrustschiessen (15530)/ | 2026-01-04 14:11 | - | |
| Armourdillo (412)/ | 2026-01-04 14:11 | - | |
| Arms (16807)/ | 2026-01-04 14:11 | - | |
| Armut & Reichtum (413)/ | 2026-01-04 14:11 | - | |
| Army (12347)/ | 2026-01-04 14:11 | - | |
| Army-Force (418)/ | 2026-01-04 14:11 | - | |
| Army Days (414)/ | 2026-01-04 14:11 | - | |
| Army Days (16452)/ | 2026-01-04 14:11 | - | |
| Army Leader (415)/ | 2026-01-04 14:11 | - | |
| Army Men (416)/ | 2026-01-04 14:11 | - | |
| Army Moves (417)/ | 2026-01-04 14:11 | - | |
| Army Moves (16272)/ | 2026-01-04 14:11 | - | |
| Arne Weise (12181)/ | 2026-01-04 14:11 | - | |
| Arnie's America's Cup Challenge (421)/ | 2026-01-04 14:11 | - | |
| Arnie (419)/ | 2026-01-04 14:11 | - | |
| Arnie Armchair's Howzat (11790)/ | 2026-01-04 14:11 | - | |
| Arnie II (420)/ | 2026-01-04 14:11 | - | |
| Arnold the Adventurer (10124)/ | 2026-01-04 14:11 | - | |
| Around the World (11680)/ | 2026-01-04 14:11 | - | |
| Arpa Magica (15137)/ | 2026-01-04 14:11 | - | |
| Arrivo (16919)/ | 2026-01-04 14:11 | - | |
| Arrow (422)/ | 2026-01-04 14:11 | - | |
| Arrow Busters (16306)/ | 2026-01-04 14:11 | - | |
| Arrow Shoot (15693)/ | 2026-01-04 14:11 | - | |
| Arrow of Death - Part 1 (423)/ | 2026-01-04 14:11 | - | |
| Arrow of Death - Part 2 (424)/ | 2026-01-04 14:11 | - | |
| Arrrgh! (10802)/ | 2026-01-04 14:11 | - | |
| Arscet (425)/ | 2026-01-04 14:11 | - | |
| Art Auction (13868)/ | 2026-01-04 14:11 | - | |
| Artax (427)/ | 2026-01-04 14:11 | - | |
| Artemis (428)/ | 2026-01-04 14:11 | - | |
| Arthema [Preview] (429)/ | 2026-01-04 14:11 | - | |
| Artillery '90 (431)/ | 2026-01-04 14:11 | - | |
| Artillery (430)/ | 2026-01-04 14:11 | - | |
| Artillery (10459)/ | 2026-01-04 14:11 | - | |
| Artillery (15745)/ | 2026-01-04 14:11 | - | |
| Artillery (17662)/ | 2026-01-04 14:11 | - | |
| Artillery Control (15474)/ | 2026-01-04 14:11 | - | |
| Artillery Duel (432)/ | 2026-01-04 14:11 | - | |
| Artris (433)/ | 2026-01-04 14:11 | - | |
| Artura (434)/ | 2026-01-04 14:11 | - | |
| Asgard (435)/ | 2026-01-04 14:11 | - | |
| Asgard (15232)/ | 2026-01-04 14:11 | - | |
| Ashby Manor (11224)/ | 2026-01-04 14:11 | - | |
| Ashes Tour 1993 (11225)/ | 2026-01-04 14:11 | - | |
| Ashido (436)/ | 2026-01-04 14:11 | - | |
| Ashido (13633)/ | 2026-01-04 14:11 | - | |
| Asi - Planet des Todes (437)/ | 2026-01-04 14:11 | - | |
| Asiatische Hauptstaedte (15531)/ | 2026-01-04 14:11 | - | |
| Aspar GP Master (438)/ | 2026-01-04 14:11 | - | |
| Aspar GP Master (11947)/ | 2026-01-04 14:11 | - | |
| Assassins [Preview] (439)/ | 2026-01-04 14:11 | - | |
| Assault Course (440)/ | 2026-01-04 14:11 | - | |
| Assault Machine (441)/ | 2026-01-04 14:11 | - | |
| Assault on Memory Alpha (442)/ | 2026-01-04 14:11 | - | |
| Assault on the Shevardino Redoubt (5142)/ | 2026-01-04 14:11 | - | |
| Assembly Line (17529)/ | 2026-01-04 14:11 | - | |
| Asset Stripper (17461)/ | 2026-01-04 14:11 | - | |
| Astatin (443)/ | 2026-01-04 14:11 | - | |
| Asterix (444)/ | 2026-01-04 14:11 | - | |
| Asterix and the Magic Cauldron (445)/ | 2026-01-04 14:11 | - | |
| Asterix im Morgenland (446)/ | 2026-01-04 14:11 | - | |
| Asterix und Obelix - Die Odyssey (447)/ | 2026-01-04 14:11 | - | |
| Asteroid ! (12384)/ | 2026-01-04 14:11 | - | |
| Asteroid (15961)/ | 2026-01-04 14:11 | - | |
| Asteroid Alert (17669)/ | 2026-01-04 14:11 | - | |
| Asteroid Belt (448)/ | 2026-01-04 14:11 | - | |
| Asteroid Belt (17321)/ | 2026-01-04 14:11 | - | |
| Asteroid Blast (10651)/ | 2026-01-04 14:11 | - | |
| Asteroid Field (13869)/ | 2026-01-04 14:11 | - | |
| Asteroid Lander (449)/ | 2026-01-04 14:11 | - | |
| Asteroid Storm (12685)/ | 2026-01-04 14:11 | - | |
| Asteroid War (450)/ | 2026-01-04 14:11 | - | |
| Asteroide (14124)/ | 2026-01-04 14:11 | - | |
| Asteroids (451)/ | 2026-01-04 14:11 | - | |
| Asteroids (15713)/ | 2026-01-04 14:11 | - | |
| Asteroids 64 (452)/ | 2026-01-04 14:11 | - | |
| Astonishing Adventures of Mr. Weems and the She Vampires, The (5062)/ | 2026-01-04 14:11 | - | |
| Astral Attack (453)/ | 2026-01-04 14:11 | - | |
| Astral Attack (14559)/ | 2026-01-04 14:11 | - | |
| Astral Zone (454)/ | 2026-01-04 14:11 | - | |
| Astray in Jungle (13621)/ | 2026-01-04 14:11 | - | |
| Astraz (455)/ | 2026-01-04 14:11 | - | |
| Astraz (15388)/ | 2026-01-04 14:11 | - | |
| Astro-Grover (10467)/ | 2026-01-04 14:11 | - | |
| Astro-Grover (16153)/ | 2026-01-04 14:11 | - | |
| Astro-Mine [Preview] (462)/ | 2026-01-04 14:11 | - | |
| Astro-PANIC! (463)/ | 2026-01-04 14:11 | - | |
| Astro Belts (11226)/ | 2026-01-04 14:11 | - | |
| Astro Blaster (456)/ | 2026-01-04 14:11 | - | |
| Astro Blaster (457)/ | 2026-01-04 14:11 | - | |
| Astro Chase (458)/ | 2026-01-04 14:11 | - | |
| Astro Dodge (459)/ | 2026-01-04 14:11 | - | |
| Astro Dodge (13725)/ | 2026-01-04 14:11 | - | |
| Astro Fighter (11227)/ | 2026-01-04 14:11 | - | |
| Astro Joe (14125)/ | 2026-01-04 14:11 | - | |
| Astro Pilot (460)/ | 2026-01-04 14:11 | - | |
| Astro Wars (13233)/ | 2026-01-04 14:11 | - | |
| Astro Wars [Preview] (461)/ | 2026-01-04 14:11 | - | |
| Astro Worm (10192)/ | 2026-01-04 14:11 | - | |
| Astroblast (15138)/ | 2026-01-04 14:11 | - | |
| Astroblaster (464)/ | 2026-01-04 14:11 | - | |
| Astroblitz (465)/ | 2026-01-04 14:11 | - | |
| Astrodome [Preview] (10611)/ | 2026-01-04 14:11 | - | |
| Astrodus Affair - The New Edition, The (9117)/ | 2026-01-04 14:11 | - | |
| Astroids (466)/ | 2026-01-04 14:11 | - | |
| Astroman (14126)/ | 2026-01-04 14:11 | - | |
| Astromania - Journey (467)/ | 2026-01-04 14:11 | - | |
| Astronaut (468)/ | 2026-01-04 14:11 | - | |
| Astronaut (13737)/ | 2026-01-04 14:11 | - | |
| Astronaut Battle (11174)/ | 2026-01-04 14:11 | - | |
| Astronauta (16333)/ | 2026-01-04 14:11 | - | |
| Astronauta (16334)/ | 2026-01-04 14:11 | - | |
| Astrosmash! (11228)/ | 2026-01-04 14:11 | - | |
| Astrostorm (15978)/ | 2026-01-04 14:11 | - | |
| Asylum (469)/ | 2026-01-04 14:11 | - | |
| Asylum (470)/ | 2026-01-04 14:11 | - | |
| Ata - The Revenge (472)/ | 2026-01-04 14:11 | - | |
| Atak Sapera (9081)/ | 2026-01-04 14:11 | - | |
| Atalan (473)/ | 2026-01-04 14:11 | - | |
| Atari II (13805)/ | 2026-01-04 14:11 | - | |
| Atari II (13870)/ | 2026-01-04 14:11 | - | |
| Athena (475)/ | 2026-01-04 14:11 | - | |
| Atlantean Odyssey (476)/ | 2026-01-04 14:11 | - | |
| Atlantic Cowboy (16672)/ | 2026-01-04 14:11 | - | |
| Atlantic Patrol (9223)/ | 2026-01-04 14:11 | - | |
| Atlantic Patrol (14745)/ | 2026-01-04 14:11 | - | |
| Atlantide (15864)/ | 2026-01-04 14:11 | - | |
| Atlantis (477)/ | 2026-01-04 14:11 | - | |
| Atlantis (478)/ | 2026-01-04 14:11 | - | |
| Atlantis (9287)/ | 2026-01-04 14:11 | - | |
| Atlantis (15733)/ | 2026-01-04 14:11 | - | |
| Atlantis Boulder (479)/ | 2026-01-04 14:11 | - | |
| Atlantis History (15621)/ | 2026-01-04 14:11 | - | |
| Atlantis Lode Runner (14270)/ | 2026-01-04 14:11 | - | |
| Atlaxmax [Preview] (9506)/ | 2026-01-04 14:11 | - | |
| Atom (12632)/ | 2026-01-04 14:11 | - | |
| Atom Ant - Up and Atom (480)/ | 2026-01-04 14:11 | - | |
| Atom Box (11912)/ | 2026-01-04 14:11 | - | |
| Atom Shoot (481)/ | 2026-01-04 14:11 | - | |
| Atom X (482)/ | 2026-01-04 14:11 | - | |
| Atomic Handball (483)/ | 2026-01-04 14:11 | - | |
| Atomic Isle (10125)/ | 2026-01-04 14:11 | - | |
| Atomic Robo-Kid (484)/ | 2026-01-04 14:11 | - | |
| Atomino (485)/ | 2026-01-04 14:11 | - | |
| Atomino (13871)/ | 2026-01-04 14:11 | - | |
| Atomix (486)/ | 2026-01-04 14:11 | - | |
| Atomkraftwerk (13582)/ | 2026-01-04 14:11 | - | |
| A to snad ne! (14432)/ | 2026-01-04 14:11 | - | |
| Attacchino (9884)/ | 2026-01-04 14:11 | - | |
| Attacco Klingoniano (12041)/ | 2026-01-04 14:11 | - | |
| Attacco Nemico (13614)/ | 2026-01-04 14:11 | - | |
| Attacco Rosso (12039)/ | 2026-01-04 14:11 | - | |
| Attacco al Bunker (16335)/ | 2026-01-04 14:11 | - | |
| Attack (15746)/ | 2026-01-04 14:11 | - | |
| Attack Chopper! (10948)/ | 2026-01-04 14:11 | - | |
| Attack Force (487)/ | 2026-01-04 14:11 | - | |
| Attack Hovercraft (488)/ | 2026-01-04 14:11 | - | |
| Attacker (9378)/ | 2026-01-04 14:11 | - | |
| Attacker (17656)/ | 2026-01-04 14:11 | - | |
| Attack into Russia! (489)/ | 2026-01-04 14:11 | - | |
| Attack of the Atlanteans (13180)/ | 2026-01-04 14:11 | - | |
| Attack of the Blue Bomber, The [Preview] (17431)/ | 2026-01-04 14:11 | - | |
| Attack of the Mutant Ninja Blueberries (10421)/ | 2026-01-04 14:11 | - | |
| Attack of the Phantom Karate Devils, The (490)/ | 2026-01-04 14:11 | - | |
| Attack of the Slime Creatures (11837)/ | 2026-01-04 14:11 | - | |
| Attack of the Software Pirates (14746)/ | 2026-01-04 14:11 | - | |
| Attack of the Tomato (14747)/ | 2026-01-04 14:11 | - | |
| Attack of the Vogons (14560)/ | 2026-01-04 14:11 | - | |
| Attack on Windscale (491)/ | 2026-01-04 14:11 | - | |
| Attaco Aero (15139)/ | 2026-01-04 14:11 | - | |
| Attento All'Acido (16336)/ | 2026-01-04 14:11 | - | |
| At the Market (15557)/ | 2026-01-04 14:11 | - | |
| Attribute Blocks (15140)/ | 2026-01-04 14:11 | - | |
| Auf Los geht's los (11678)/ | 2026-01-04 14:11 | - | |
| Auf Wiedersehen Monty (494)/ | 2026-01-04 14:11 | - | |
| Auf Wiedersehen Pet (13514)/ | 2026-01-04 14:11 | - | |
| Auf der Suche (493)/ | 2026-01-04 14:11 | - | |
| Aufstand der Sioux (15141)/ | 2026-01-04 14:11 | - | |
| Augie Doggie and Doggier Daddy (495)/ | 2026-01-04 14:11 | - | |
| Auld Lang Syne (12438)/ | 2026-01-04 14:11 | - | |
| Aural Manoeuvres II (15142)/ | 2026-01-04 14:11 | - | |
| Auriga (496)/ | 2026-01-04 14:11 | - | |
| Ausbruch (17112)/ | 2026-01-04 14:11 | - | |
| Auschwitz Games - The Final Clean Up of Germany (13872)/ | 2026-01-04 14:11 | - | |
| Auschwitz Games - The Final Clean Up of Germany (13873)/ | 2026-01-04 14:11 | - | |
| Aussie Assault (11230)/ | 2026-01-04 14:11 | - | |
| Aussie Cricket (11231)/ | 2026-01-04 14:11 | - | |
| Aussie Games (497)/ | 2026-01-04 14:11 | - | |
| Aussie Trip (11232)/ | 2026-01-04 14:11 | - | |
| Austerlitz (15450)/ | 2026-01-04 14:11 | - | |
| Australian Rules Football (498)/ | 2026-01-04 14:11 | - | |
| Australopiticus Robustus (499)/ | 2026-01-04 14:11 | - | |
| Austriadash 01 (500)/ | 2026-01-04 14:11 | - | |
| Austriadash 02 (501)/ | 2026-01-04 14:11 | - | |
| Aut Caesar... (16337)/ | 2026-01-04 14:11 | - | |
| Author (15809)/ | 2026-01-04 14:11 | - | |
| Auto-Rallye (12406)/ | 2026-01-04 14:11 | - | |
| Auto 001 (17236)/ | 2026-01-04 14:11 | - | |
| Auto 64 (15355)/ | 2026-01-04 14:11 | - | |
| Auto Dash 01 (17237)/ | 2026-01-04 14:11 | - | |
| Auto Dash 02 (17238)/ | 2026-01-04 14:11 | - | |
| Auto Dash 03 (17239)/ | 2026-01-04 14:11 | - | |
| Auto Dash 04 (17240)/ | 2026-01-04 14:11 | - | |
| Auto Dash 05 (17241)/ | 2026-01-04 14:11 | - | |
| Auto Dash 06 (17242)/ | 2026-01-04 14:11 | - | |
| Auto Dash 07 (17243)/ | 2026-01-04 14:11 | - | |
| Auto Dash 08 (17244)/ | 2026-01-04 14:11 | - | |
| Auto Dash 09 (17245)/ | 2026-01-04 14:11 | - | |
| Auto Dash 10 (17246)/ | 2026-01-04 14:11 | - | |
| Auto Dash 11 (17247)/ | 2026-01-04 14:11 | - | |
| Auto Dash 12 (17248)/ | 2026-01-04 14:11 | - | |
| Auto Dash 13 (17249)/ | 2026-01-04 14:11 | - | |
| Auto Dash 14 (17250)/ | 2026-01-04 14:11 | - | |
| Auto Dash 15 (17251)/ | 2026-01-04 14:11 | - | |
| Auto Dash 16 (17252)/ | 2026-01-04 14:11 | - | |
| Auto Dash 17 (17253)/ | 2026-01-04 14:11 | - | |
| Auto Dash 18 (17254)/ | 2026-01-04 14:11 | - | |
| Auto Dash 19 (17255)/ | 2026-01-04 14:11 | - | |
| Auto Dash 20 (17256)/ | 2026-01-04 14:11 | - | |
| Auto Dash 21 (17257)/ | 2026-01-04 14:11 | - | |
| Auto Dash 22 (17258)/ | 2026-01-04 14:11 | - | |
| Auto Dash 23 (17259)/ | 2026-01-04 14:11 | - | |
| Auto Dash 24 (17260)/ | 2026-01-04 14:11 | - | |
| Auto Dash 25 (17261)/ | 2026-01-04 14:11 | - | |
| Auto Dash 26 (17262)/ | 2026-01-04 14:11 | - | |
| Auto Dash 27 (17263)/ | 2026-01-04 14:11 | - | |
| Auto Dash 28 (17264)/ | 2026-01-04 14:11 | - | |
| Auto Dash 29 (17265)/ | 2026-01-04 14:11 | - | |
| Auto Dash 30 (17266)/ | 2026-01-04 14:11 | - | |
| Auto Duel (502)/ | 2026-01-04 14:11 | - | |
| Auto Mania - Manic Mechanic (503)/ | 2026-01-04 14:11 | - | |
| Auto Racer (15462)/ | 2026-01-04 14:11 | - | |
| Auto Rallye! (11229)/ | 2026-01-04 14:11 | - | |
| Auto Scontro (16338)/ | 2026-01-04 14:11 | - | |
| Autocontrol (17005)/ | 2026-01-04 14:11 | - | |
| Autoduel (504)/ | 2026-01-04 14:11 | - | |
| Automan (505)/ | 2026-01-04 14:11 | - | |
| Automatic Board Computer [Preview] (506)/ | 2026-01-04 14:11 | - | |
| Autorennen (14748)/ | 2026-01-04 14:11 | - | |
| Autosalto (12040)/ | 2026-01-04 14:11 | - | |
| Autotest (507)/ | 2026-01-04 14:11 | - | |
| Autoverseny (15579)/ | 2026-01-04 14:11 | - | |
| Autowueste (13666)/ | 2026-01-04 14:11 | - | |
| Avalange (508)/ | 2026-01-04 14:11 | - | |
| Avaruuden Valtaus (14749)/ | 2026-01-04 14:11 | - | |
| Avenger (509)/ | 2026-01-04 14:11 | - | |
| Avenger (510)/ | 2026-01-04 14:11 | - | |
| Avengers (10254)/ | 2026-01-04 14:11 | - | |
| Aventura Espacial, La - La Conga vs El Celo (9307)/ | 2026-01-04 14:11 | - | |
| Aventura Original, La (10175)/ | 2026-01-04 14:11 | - | |
| Avoid 'em [Preview] (512)/ | 2026-01-04 14:11 | - | |
| Avoid (511)/ | 2026-01-04 14:11 | - | |
| Avoid and Catch (11420)/ | 2026-01-04 14:11 | - | |
| Avoid the Noid (513)/ | 2026-01-04 14:11 | - | |
| Avventura (15009)/ | 2026-01-04 14:11 | - | |
| Avventura I (12046)/ | 2026-01-04 14:11 | - | |
| Avventura in Grecia (15862)/ | 2026-01-04 14:11 | - | |
| Avventura nel Computer (16339)/ | 2026-01-04 14:11 | - | |
| Avventure di Jack Byteson I, Le - Strani Incontri A Chinatown (15852)/ | 2026-01-04 14:11 | - | |
| Avventure di Jack Byteson II, Le - Potenze Oscure (17018)/ | 2026-01-04 14:11 | - | |
| Avventure di Jack Byteson III, Le - La Tomba dei Navajo (17019)/ | 2026-01-04 14:11 | - | |
| Avventure di Jack Byteson IV, Le - Tay-Gy (17020)/ | 2026-01-04 14:11 | - | |
| Aw-Somi - The Inner Sanctum (16049)/ | 2026-01-04 14:11 | - | |
| Awari (514)/ | 2026-01-04 14:11 | - | |
| Awari (10672)/ | 2026-01-04 14:11 | - | |
| Awari (10840)/ | 2026-01-04 14:11 | - | |
| Axe of Rage (10580)/ | 2026-01-04 14:11 | - | |
| Axiens (515)/ | 2026-01-04 14:11 | - | |
| Axis Assassin (516)/ | 2026-01-04 14:11 | - | |
| Azione (14102)/ | 2026-01-04 14:11 | - | |
| Aztec (517)/ | 2026-01-04 14:11 | - | |
| Aztec Challenge (518)/ | 2026-01-04 14:11 | - | |
| Aztec Tomb (519)/ | 2026-01-04 14:11 | - | |
| Aztec Tomb H (13888)/ | 2026-01-04 14:11 | - | |
| Aztec Tomb Revisited (520)/ | 2026-01-04 14:11 | - | |
| Azteca (14127)/ | 2026-01-04 14:11 | - | |
|
|---|