![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | O'Riley's Mine (5328)/ | 2026-01-04 14:12 | - | |
| OBY 1 (5334)/ | 2026-01-04 14:12 | - | |
| OHG (5355)/ | 2026-01-04 14:12 | - | |
| OHM's Law (14406)/ | 2026-01-04 14:12 | - | |
| OK KO (14048)/ | 2026-01-04 14:12 | - | |
| OU (10112)/ | 2026-01-04 14:12 | - | |
| OUT (5477)/ | 2026-01-04 14:12 | - | |
| OXO (14658)/ | 2026-01-04 14:12 | - | |
| Oak Flat Nuclear Power Plant Simulator (11325)/ | 2026-01-04 14:12 | - | |
| Oasis (5329)/ | 2026-01-04 14:12 | - | |
| Oasis of Shalimar, The (5330)/ | 2026-01-04 14:12 | - | |
| Obico (11326)/ | 2026-01-04 14:12 | - | |
| Obicontrol (5331)/ | 2026-01-04 14:12 | - | |
| Objective 1.1 (16970)/ | 2026-01-04 14:12 | - | |
| Oblivion (5332)/ | 2026-01-04 14:12 | - | |
| Obstacle Course (11836)/ | 2026-01-04 14:12 | - | |
| Obstdieb (17293)/ | 2026-01-04 14:12 | - | |
| Obsternte (5333)/ | 2026-01-04 14:12 | - | |
| Ocean Conqueror (5335)/ | 2026-01-04 14:12 | - | |
| Ocean Life Project, The (14965)/ | 2026-01-04 14:12 | - | |
| Ocean Ranger (5337)/ | 2026-01-04 14:12 | - | |
| Ocean of Life, The (5336)/ | 2026-01-04 14:12 | - | |
| Octagon Pinball (5338)/ | 2026-01-04 14:12 | - | |
| Octapolis (5339)/ | 2026-01-04 14:12 | - | |
| Octoplex (5340)/ | 2026-01-04 14:12 | - | |
| Octopus (14830)/ | 2026-01-04 14:12 | - | |
| Octopus-Adventure (5341)/ | 2026-01-04 14:12 | - | |
| Octopus Maze, The (5342)/ | 2026-01-04 14:12 | - | |
| Odd One Out (5343)/ | 2026-01-04 14:12 | - | |
| Oddball (15650)/ | 2026-01-04 14:12 | - | |
| Oddball II - Levity Now (16005)/ | 2026-01-04 14:12 | - | |
| Oddessy (10086)/ | 2026-01-04 14:12 | - | |
| Odell Lake (9294)/ | 2026-01-04 14:12 | - | |
| Odin (5344)/ | 2026-01-04 14:12 | - | |
| Odinshrine (11327)/ | 2026-01-04 14:12 | - | |
| Odisea Espacial (14181)/ | 2026-01-04 14:12 | - | |
| Odradek - Microstudies in Artificial Intelligence #3 (13662)/ | 2026-01-04 14:12 | - | |
| Odysee II (14840)/ | 2026-01-04 14:12 | - | |
| Odyssee - Kampf der Bruderschaft (5345)/ | 2026-01-04 14:12 | - | |
| Odysseus - Trojan Warrior (8168)/ | 2026-01-04 14:12 | - | |
| Odyssey (5346)/ | 2026-01-04 14:12 | - | |
| Odyssey (10918)/ | 2026-01-04 14:12 | - | |
| Odyssey, The (5348)/ | 2026-01-04 14:12 | - | |
| Odyssey, The (16869)/ | 2026-01-04 14:12 | - | |
| Odyssey - Kampf mit der Wildnis (5347)/ | 2026-01-04 14:12 | - | |
| Oel (5349)/ | 2026-01-04 14:12 | - | |
| Oel (15421)/ | 2026-01-04 14:12 | - | |
| Official Father Christmas Game, The (2689)/ | 2026-01-04 14:12 | - | |
| Off the Walls (5350)/ | 2026-01-04 14:12 | - | |
| Ograton (5351)/ | 2026-01-04 14:12 | - | |
| Ograton II - The Revenge (5352)/ | 2026-01-04 14:12 | - | |
| Ogre (5353)/ | 2026-01-04 14:12 | - | |
| Og the Great (10332)/ | 2026-01-04 14:12 | - | |
| Oh No! (5354)/ | 2026-01-04 14:12 | - | |
| Oil Barons (5356)/ | 2026-01-04 14:12 | - | |
| Oil Challenge (5357)/ | 2026-01-04 14:12 | - | |
| Oil Defense (5358)/ | 2026-01-04 14:12 | - | |
| Oil Imperium (5359)/ | 2026-01-04 14:12 | - | |
| Oil Imperium (14399)/ | 2026-01-04 14:12 | - | |
| Oil Imperium (14505)/ | 2026-01-04 14:12 | - | |
| Oil Strike (15097)/ | 2026-01-04 14:12 | - | |
| Oil Tycoon (5360)/ | 2026-01-04 14:12 | - | |
| Oilmania (5361)/ | 2026-01-04 14:12 | - | |
| Oilpoly (15070)/ | 2026-01-04 14:12 | - | |
| Oils Well (5362)/ | 2026-01-04 14:12 | - | |
| Oink! (5363)/ | 2026-01-04 14:12 | - | |
| Oklahoma Kid (5364)/ | 2026-01-04 14:12 | - | |
| Ol' Bean, The (15659)/ | 2026-01-04 14:12 | - | |
| Old Bones Dice (10250)/ | 2026-01-04 14:12 | - | |
| Old MacDonald's Farm (16396)/ | 2026-01-04 14:12 | - | |
| Old Sam - The Bridgebuilder (17052)/ | 2026-01-04 14:12 | - | |
| Old Shell Game (12881)/ | 2026-01-04 14:12 | - | |
| Old World, The [Preview] (5365)/ | 2026-01-04 14:12 | - | |
| Oldbones (9386)/ | 2026-01-04 14:12 | - | |
| Older (14034)/ | 2026-01-04 14:12 | - | |
| Olimpia (14182)/ | 2026-01-04 14:12 | - | |
| Olli & Lissa - The Ghost of Shilmoore Castle (5366)/ | 2026-01-04 14:12 | - | |
| Olli & Lissa 3 - The Candlelight Adventure (5367)/ | 2026-01-04 14:12 | - | |
| Ollie's Follies (5368)/ | 2026-01-04 14:12 | - | |
| Ollo (5369)/ | 2026-01-04 14:12 | - | |
| Ollo II - The Final Conflict (5370)/ | 2026-01-04 14:12 | - | |
| Olo (5371)/ | 2026-01-04 14:12 | - | |
| Olympiad (9606)/ | 2026-01-04 14:12 | - | |
| Olympic Biathlon (9121)/ | 2026-01-04 14:12 | - | |
| Olympic Skier (5372)/ | 2026-01-04 14:12 | - | |
| Olympic Task 800 (5373)/ | 2026-01-04 14:12 | - | |
| Olympics 84 (17435)/ | 2026-01-04 14:12 | - | |
| Olympics 2004 Athens (17058)/ | 2026-01-04 14:12 | - | |
| Omega (5374)/ | 2026-01-04 14:12 | - | |
| Omega - Der Geheime Planet (3090)/ | 2026-01-04 14:12 | - | |
| Omega - Planete Invisible (5376)/ | 2026-01-04 14:12 | - | |
| Omega Battle (11945)/ | 2026-01-04 14:12 | - | |
| Omega Ceti [Preview] (9657)/ | 2026-01-04 14:12 | - | |
| Omega Force One (5375)/ | 2026-01-04 14:12 | - | |
| Omega Race (5377)/ | 2026-01-04 14:12 | - | |
| Omega Race (13162)/ | 2026-01-04 14:12 | - | |
| Omega Race (16532)/ | 2026-01-04 14:12 | - | |
| Omega Race II (5378)/ | 2026-01-04 14:12 | - | |
| Omega Run, The (5379)/ | 2026-01-04 14:12 | - | |
| Omicron (5380)/ | 2026-01-04 14:12 | - | |
| Omicron (5381)/ | 2026-01-04 14:12 | - | |
| Omidar (5382)/ | 2026-01-04 14:12 | - | |
| Omni-Play Basketball (5383)/ | 2026-01-04 14:12 | - | |
| Omni-Play Horse Racing - Sport of Kings (5384)/ | 2026-01-04 14:12 | - | |
| Omnibus (11320)/ | 2026-01-04 14:12 | - | |
| Omnibus GmbH (5385)/ | 2026-01-04 14:12 | - | |
| Omniopoly (14654)/ | 2026-01-04 14:12 | - | |
| On Court Tennis (5388)/ | 2026-01-04 14:12 | - | |
| On Court Tennis II (5389)/ | 2026-01-04 14:12 | - | |
| On Cue (5390)/ | 2026-01-04 14:12 | - | |
| On Field Football (5392)/ | 2026-01-04 14:12 | - | |
| On Green (5393)/ | 2026-01-04 14:12 | - | |
| On Ice (5394)/ | 2026-01-04 14:12 | - | |
| On Table [Preview] (5395)/ | 2026-01-04 14:12 | - | |
| On Track Racing (5399)/ | 2026-01-04 14:12 | - | |
| On a Move (5387)/ | 2026-01-04 14:12 | - | |
| Onderzeeboot (5400)/ | 2026-01-04 14:12 | - | |
| One (13206)/ | 2026-01-04 14:12 | - | |
| One-Armed Bandit (14549)/ | 2026-01-04 14:12 | - | |
| One-Day Cricket (16444)/ | 2026-01-04 14:12 | - | |
| One Arm Bandit (5401)/ | 2026-01-04 14:12 | - | |
| One Armed Bandit (14655)/ | 2026-01-04 14:12 | - | |
| One Bite Too Deep (5402)/ | 2026-01-04 14:12 | - | |
| One Man Army [Preview] (5404)/ | 2026-01-04 14:12 | - | |
| One Man and his Droid (5403)/ | 2026-01-04 14:12 | - | |
| One for One (13414)/ | 2026-01-04 14:12 | - | |
| One on One (5405)/ | 2026-01-04 14:12 | - | |
| One on One (10249)/ | 2026-01-04 14:12 | - | |
| One on One Backyard Basketball (5406)/ | 2026-01-04 14:12 | - | |
| One to Five (15548)/ | 2026-01-04 14:12 | - | |
| One to One (9128)/ | 2026-01-04 14:12 | - | |
| On the Bench (11191)/ | 2026-01-04 14:12 | - | |
| On the Moon (5396)/ | 2026-01-04 14:12 | - | |
| On the Tiles (5398)/ | 2026-01-04 14:12 | - | |
| On the Way to the Interview (9365)/ | 2026-01-04 14:12 | - | |
| Ontsnapping, De (16303)/ | 2026-01-04 14:12 | - | |
| Oo-Topos (9763)/ | 2026-01-04 14:12 | - | |
| Ooops Up [Preview] (5407)/ | 2026-01-04 14:12 | - | |
| Oops! (5408)/ | 2026-01-04 14:12 | - | |
| Oops [Preview] (5409)/ | 2026-01-04 14:12 | - | |
| Opac (15930)/ | 2026-01-04 14:12 | - | |
| Opaque Dungeons (5411)/ | 2026-01-04 14:12 | - | |
| Open Golfing at Royal St. Georges (13219)/ | 2026-01-04 14:12 | - | |
| Open Seas, The (5412)/ | 2026-01-04 14:12 | - | |
| Open Sesame (5413)/ | 2026-01-04 14:12 | - | |
| Opera House (5414)/ | 2026-01-04 14:12 | - | |
| Operation - FROG (5420)/ | 2026-01-04 14:12 | - | |
| Operation - Sabotage (10823)/ | 2026-01-04 14:12 | - | |
| Operation Anoria (5415)/ | 2026-01-04 14:12 | - | |
| Operation Brown Trousers (11321)/ | 2026-01-04 14:12 | - | |
| Operation Escape (5417)/ | 2026-01-04 14:12 | - | |
| Operation Feuersturm (16230)/ | 2026-01-04 14:12 | - | |
| Operation Fireball (5418)/ | 2026-01-04 14:12 | - | |
| Operation Fox (5419)/ | 2026-01-04 14:12 | - | |
| Operation Hanoi (5421)/ | 2026-01-04 14:12 | - | |
| Operation Hongkong (5422)/ | 2026-01-04 14:12 | - | |
| Operation Hormuz (5423)/ | 2026-01-04 14:12 | - | |
| Operation Iceberg - The Battle for Okinawa (9310)/ | 2026-01-04 14:12 | - | |
| Operation Ironhawk (5424)/ | 2026-01-04 14:12 | - | |
| Operation Lemmings (10248)/ | 2026-01-04 14:12 | - | |
| Operation Market Garden (12177)/ | 2026-01-04 14:12 | - | |
| Operation Merkur (5425)/ | 2026-01-04 14:12 | - | |
| Operation Merkur (10497)/ | 2026-01-04 14:12 | - | |
| Operation Neptun (5426)/ | 2026-01-04 14:12 | - | |
| Operation Neptune (5427)/ | 2026-01-04 14:12 | - | |
| Operation Proboszcz (5428)/ | 2026-01-04 14:12 | - | |
| Operation Swordfish (5429)/ | 2026-01-04 14:12 | - | |
| Operation Terminal (5430)/ | 2026-01-04 14:12 | - | |
| Operation Thunderbolt (5431)/ | 2026-01-04 14:12 | - | |
| Operation Ushkurat (14279)/ | 2026-01-04 14:12 | - | |
| Operation Whirlwind (5432)/ | 2026-01-04 14:12 | - | |
| Operation Wolf (5433)/ | 2026-01-04 14:12 | - | |
| Operation Wolf (5434)/ | 2026-01-04 14:12 | - | |
| Operation Wolf (16448)/ | 2026-01-04 14:12 | - | |
| Opium (5435)/ | 2026-01-04 14:12 | - | |
| Opium (13161)/ | 2026-01-04 14:12 | - | |
| Opror Pa Nyx (14120)/ | 2026-01-04 14:12 | - | |
| Optima Rax (5436)/ | 2026-01-04 14:12 | - | |
| Ora Sparo (15616)/ | 2026-01-04 14:12 | - | |
| Oracle's Cave, The (5440)/ | 2026-01-04 14:12 | - | |
| Oracle (5437)/ | 2026-01-04 14:12 | - | |
| Oracle II (5438)/ | 2026-01-04 14:12 | - | |
| Oracle III [Preview] (5439)/ | 2026-01-04 14:12 | - | |
| Orange Squash (5442)/ | 2026-01-04 14:12 | - | |
| Orathan (16653)/ | 2026-01-04 14:12 | - | |
| Orazio (15424)/ | 2026-01-04 14:12 | - | |
| Orb (5443)/ | 2026-01-04 14:12 | - | |
| Orbit (5445)/ | 2026-01-04 14:12 | - | |
| Orbit (5446)/ | 2026-01-04 14:12 | - | |
| Orbitron (5447)/ | 2026-01-04 14:12 | - | |
| Orbits (5448)/ | 2026-01-04 14:12 | - | |
| Orbitter (9388)/ | 2026-01-04 14:12 | - | |
| Orb of Light, The (5444)/ | 2026-01-04 14:12 | - | |
| Orbyt [Preview] (16971)/ | 2026-01-04 14:12 | - | |
| Orc's Siege (11922)/ | 2026-01-04 14:12 | - | |
| Orc Attack (5449)/ | 2026-01-04 14:12 | - | |
| Orchan - Legend of the Realm (10785)/ | 2026-01-04 14:12 | - | |
| Orcus v2.0 [Preview] (5450)/ | 2026-01-04 14:12 | - | |
| Ordeal (16354)/ | 2026-01-04 14:12 | - | |
| Ordleik (14496)/ | 2026-01-04 14:12 | - | |
| Ore Seekers, The (15817)/ | 2026-01-04 14:12 | - | |
| Oregon-Trail (10051)/ | 2026-01-04 14:12 | - | |
| Oregon Trail (11322)/ | 2026-01-04 14:12 | - | |
| Orgasmatron (5451)/ | 2026-01-04 14:12 | - | |
| Orin 1 (5452)/ | 2026-01-04 14:12 | - | |
| Orion (5453)/ | 2026-01-04 14:12 | - | |
| Orion (5454)/ | 2026-01-04 14:12 | - | |
| Orion (5455)/ | 2026-01-04 14:12 | - | |
| Orion (12337)/ | 2026-01-04 14:12 | - | |
| Orion (16610)/ | 2026-01-04 14:12 | - | |
| Orion Dash 1 (5456)/ | 2026-01-04 14:12 | - | |
| Orion Quest, The (10276)/ | 2026-01-04 14:12 | - | |
| Ork! House of Fortune (14799)/ | 2026-01-04 14:12 | - | |
| Orlando (5457)/ | 2026-01-04 14:12 | - | |
| Orm and Cheep - Narrow Squeaks (9787)/ | 2026-01-04 14:12 | - | |
| Orm and Cheep - The Birthday Party (16457)/ | 2026-01-04 14:12 | - | |
| Ormen Enormen (5458)/ | 2026-01-04 14:12 | - | |
| Ormen Nada (11436)/ | 2026-01-04 14:12 | - | |
| Ormen aeter siffror (13789)/ | 2026-01-04 14:12 | - | |
| Ormus (12415)/ | 2026-01-04 14:12 | - | |
| Ormus II (12414)/ | 2026-01-04 14:12 | - | |
| Ormus Saga, The (5459)/ | 2026-01-04 14:12 | - | |
| Ormus Saga, The II - Guild of Death (5460)/ | 2026-01-04 14:12 | - | |
| Ormus Saga, The III - The Final Chapter (11328)/ | 2026-01-04 14:12 | - | |
| Orpheus in the Underworld (5461)/ | 2026-01-04 14:12 | - | |
| Orsital (5462)/ | 2026-01-04 14:12 | - | |
| Ortotris (14396)/ | 2026-01-04 14:12 | - | |
| Oscar's Dustbin (5463)/ | 2026-01-04 14:12 | - | |
| Osero (10922)/ | 2026-01-04 14:12 | - | |
| Oskar (5464)/ | 2026-01-04 14:12 | - | |
| Oslo Bors (5465)/ | 2026-01-04 14:12 | - | |
| Osmium (5466)/ | 2026-01-04 14:12 | - | |
| Osmium II - The Revenge of FX (5467)/ | 2026-01-04 14:12 | - | |
| Osmosis (12442)/ | 2026-01-04 14:12 | - | |
| Osprey! (15507)/ | 2026-01-04 14:12 | - | |
| Ossi Dash 1 (10024)/ | 2026-01-04 14:12 | - | |
| Ossi Dash 2 (10025)/ | 2026-01-04 14:12 | - | |
| Ossidokid (5468)/ | 2026-01-04 14:12 | - | |
| Ostfrieslandgames (5469)/ | 2026-01-04 14:12 | - | |
| Otello (15584)/ | 2026-01-04 14:12 | - | |
| Oter (5470)/ | 2026-01-04 14:12 | - | |
| Othello (5471)/ | 2026-01-04 14:12 | - | |
| Othello (5472)/ | 2026-01-04 14:12 | - | |
| Othello (5473)/ | 2026-01-04 14:12 | - | |
| Othello (5474)/ | 2026-01-04 14:12 | - | |
| Othello (9449)/ | 2026-01-04 14:12 | - | |
| Othello (9604)/ | 2026-01-04 14:12 | - | |
| Othello (10738)/ | 2026-01-04 14:12 | - | |
| Othello (10739)/ | 2026-01-04 14:12 | - | |
| Othello (10740)/ | 2026-01-04 14:12 | - | |
| Othello (11329)/ | 2026-01-04 14:12 | - | |
| Othello (12659)/ | 2026-01-04 14:12 | - | |
| Othello (12828)/ | 2026-01-04 14:12 | - | |
| Othello (13159)/ | 2026-01-04 14:12 | - | |
| Othello (13160)/ | 2026-01-04 14:12 | - | |
| Othello (13190)/ | 2026-01-04 14:12 | - | |
| Othello (13227)/ | 2026-01-04 14:12 | - | |
| Othello (13696)/ | 2026-01-04 14:12 | - | |
| Othello (14651)/ | 2026-01-04 14:12 | - | |
| Othello (16242)/ | 2026-01-04 14:12 | - | |
| Othello (16412)/ | 2026-01-04 14:12 | - | |
| Othello (16426)/ | 2026-01-04 14:12 | - | |
| Otherworld (5475)/ | 2026-01-04 14:12 | - | |
| Oubliette (5476)/ | 2026-01-04 14:12 | - | |
| Ouch! (10779)/ | 2026-01-04 14:12 | - | |
| Ouch! II (15791)/ | 2026-01-04 14:12 | - | |
| Our Own Klondike (12432)/ | 2026-01-04 14:12 | - | |
| Ouranos (14852)/ | 2026-01-04 14:12 | - | |
| Out-Post (11330)/ | 2026-01-04 14:12 | - | |
| Out Run (5482)/ | 2026-01-04 14:12 | - | |
| Out Run (15254)/ | 2026-01-04 14:12 | - | |
| Out Run 1.3 (5483)/ | 2026-01-04 14:12 | - | |
| Out Run Deluxe [Preview] (5484)/ | 2026-01-04 14:12 | - | |
| Out Run Europa (5485)/ | 2026-01-04 14:12 | - | |
| Out Take II (5486)/ | 2026-01-04 14:12 | - | |
| Outback (5487)/ | 2026-01-04 14:12 | - | |
| Outcrush (5488)/ | 2026-01-04 14:12 | - | |
| Outer Reaches, The (16805)/ | 2026-01-04 14:12 | - | |
| Outer Space (9070)/ | 2026-01-04 14:12 | - | |
| Outlaw (5489)/ | 2026-01-04 14:12 | - | |
| Outlaw (5490)/ | 2026-01-04 14:12 | - | |
| Outlaw (10981)/ | 2026-01-04 14:12 | - | |
| Outlaws (5491)/ | 2026-01-04 14:12 | - | |
| Out of Boom (5478)/ | 2026-01-04 14:12 | - | |
| Out of Deep (5479)/ | 2026-01-04 14:12 | - | |
| Out of Order (12220)/ | 2026-01-04 14:12 | - | |
| Out of This World (5480)/ | 2026-01-04 14:12 | - | |
| Out on a Limb (5481)/ | 2026-01-04 14:12 | - | |
| Outpost (10247)/ | 2026-01-04 14:12 | - | |
| Outpost (10666)/ | 2026-01-04 14:12 | - | |
| Outpost (13363)/ | 2026-01-04 14:12 | - | |
| Outrider (10052)/ | 2026-01-04 14:12 | - | |
| Over-Reaction (11743)/ | 2026-01-04 14:12 | - | |
| Overkill - The Death of New Generation (5495)/ | 2026-01-04 14:12 | - | |
| Overkill - The Death of New Generation (16424)/ | 2026-01-04 14:12 | - | |
| Overlander (5496)/ | 2026-01-04 14:12 | - | |
| Overload (5497)/ | 2026-01-04 14:12 | - | |
| Overlord (9835)/ | 2026-01-04 14:12 | - | |
| Overlord (13017)/ | 2026-01-04 14:12 | - | |
| Overrun - Europe (5499)/ | 2026-01-04 14:12 | - | |
| Overrun - Mideast (9932)/ | 2026-01-04 14:12 | - | |
| Overtake (9395)/ | 2026-01-04 14:12 | - | |
| Over the Net (5492)/ | 2026-01-04 14:12 | - | |
| Over the Rainbow (5493)/ | 2026-01-04 14:12 | - | |
| Over the Top (5494)/ | 2026-01-04 14:12 | - | |
| Owari (10923)/ | 2026-01-04 14:12 | - | |
| Owen's Escape (5500)/ | 2026-01-04 14:12 | - | |
| Oxxonian (5501)/ | 2026-01-04 14:12 | - | |
| Oxyd (13622)/ | 2026-01-04 14:12 | - | |
| Ozling (16087)/ | 2026-01-04 14:12 | - | |
| Ozone II (5503)/ | 2026-01-04 14:12 | - | |
| oekolopoly (10252)/ | 2026-01-04 14:12 | - | |
| oekolopoly (11437)/ | 2026-01-04 14:12 | - | |
|
|---|